EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H10Cl2NO2.K |
| Net Charge | 0 |
| Average Mass | 334.243 |
| Monoisotopic Mass | 332.97257 |
| SMILES | O=C([O-])Cc1ccccc1Nc1c(Cl)cccc1Cl.[K+] |
| InChI | InChI=1S/C14H11Cl2NO2.K/c15-10-5-3-6-11(16)14(10)17-12-7-2-1-4-9(12)8-13(18)19;/h1-7,17H,8H2,(H,18,19);/q;+1/p-1 |
| InChIKey | KXZOIWWTXOCYKR-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. |
| Applications: | analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. antirheumatic drug A drug used to treat rheumatoid arthritis. anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diclofenac potassium (CHEBI:4508) has part diclofenac(1−) (CHEBI:48311) |
| diclofenac potassium (CHEBI:4508) has role analgesic (CHEBI:35480) |
| diclofenac potassium (CHEBI:4508) has role anti-inflammatory agent (CHEBI:67079) |
| diclofenac potassium (CHEBI:4508) has role anti-ulcer drug (CHEBI:49201) |
| diclofenac potassium (CHEBI:4508) has role antirheumatic drug (CHEBI:35842) |
| diclofenac potassium (CHEBI:4508) is a potassium salt (CHEBI:26218) |
| IUPAC Name |
|---|
| potassium {2-[(2,6-dichlorophenyl)amino]phenyl}acetate |
| Synonyms | Source |
|---|---|
| 2-((2,6-dichlorophenyl)amino)benzeneacetic acid, monopotassium salt | ChemIDplus |
| CGP 45840B | ChEMBL |
| CGP-45840B | ChEMBL |
| Diclofenac potassium | ChEMBL |
| Diclofenac potassium salt | ChEMBL |
| Potassium diclofenac | ChEMBL |
| Brand Names | Source |
|---|---|
| Cambia | ChEMBL |
| Cataflam | DrugBank |
| Voltarol joint pain | ChEMBL |
| Voltarol pain-eze | ChEMBL |
| Voltarol pain-eze extra strgh | ChEMBL |
| Voltarol rapid | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6625757 | Beilstein |
| CAS:15307-81-0 | ChemIDplus |
| Citations |
|---|