EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:4509 - diclofenac sodium
| Formula | C14H10Cl2NO2.Na |
| Net Charge | 0 |
| Average Mass | 318.135 |
| Monoisotopic Mass | 316.99863 |
| SMILES | O=C([O-])Cc1ccccc1Nc1c(Cl)cccc1Cl.[Na+] |
| InChI | InChI=1S/C14H11Cl2NO2.Na/c15-10-5-3-6-11(16)14(10)17-12-7-2-1-4-9(12)8-13(18)19;/h1-7,17H,8H2,(H,18,19);/q;+1/p-1 |
| InChIKey | KPHWPUGNDIVLNH-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. |
| Applications: | gout suppressant A drug that increases uric acid excretion by the kidney (uricosuric drug), decreases uric acid production (antihyperuricemic), or alleviates the pain and inflammation of acute attacks of gout. antirheumatic drug A drug used to treat rheumatoid arthritis. anti-inflammatory agent Any compound that has anti-inflammatory effects. anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diclofenac sodium (CHEBI:4509) has part diclofenac(1−) (CHEBI:48311) |
| diclofenac sodium (CHEBI:4509) has role analgesic (CHEBI:35480) |
| diclofenac sodium (CHEBI:4509) has role anti-anaemic agent (CHEBI:75835) |
| diclofenac sodium (CHEBI:4509) has role anti-inflammatory agent (CHEBI:67079) |
| diclofenac sodium (CHEBI:4509) has role anti-ulcer drug (CHEBI:49201) |
| diclofenac sodium (CHEBI:4509) has role antibacterial agent (CHEBI:33282) |
| diclofenac sodium (CHEBI:4509) has role antineoplastic agent (CHEBI:35610) |
| diclofenac sodium (CHEBI:4509) has role antirheumatic drug (CHEBI:35842) |
| diclofenac sodium (CHEBI:4509) has role gout suppressant (CHEBI:35845) |
| diclofenac sodium (CHEBI:4509) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium {2-[(2,6-dichlorophenyl)amino]phenyl}acetate |
| Synonyms | Source |
|---|---|
| 2-((2,6-dichlorophenyl)amino)benzeneacetic acid monosodium salt | ChemIDplus |
| Abitren | ChEMBL |
| Benfofen | ChEMBL |
| Dealgic | ChEMBL |
| Deflamat | ChEMBL |
| Delphinac | ChEMBL |
| Brand Names | Source |
|---|---|
| Acoflam | ChEMBL |
| Acoflam ret | ChEMBL |
| Acoflam sr | ChEMBL |
| Arthronac | ChEMBL |
| Arthrotec 50 | ChEMBL |
| Arthrotec 75 | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3581138 | Beilstein |
| CAS:15307-79-6 | ChemIDplus |
| Citations |
|---|