EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:47002 - β-D-ribose
| Formula | C5H10O5 |
| Net Charge | 0 |
| Average Mass | 150.130 |
| Monoisotopic Mass | 150.05282 |
| SMILES | OC[C@H]1O[C@@H](O)[C@H](O)[C@@H]1O |
| WURCS | WURCS=2.0/1,1,0/[a222h-1b_1-4]/1/ |
| InChI | InChI=1S/C5H10O5/c6-1-2-3(7)4(8)5(9)10-2/h2-9H,1H2/t2-,3-,4-,5-/m1/s1 |
| InChIKey | HMFHBZSHGGEWLO-TXICZTDVSA-N |
| Roles Classification |
|---|
| Biological Roles: | fundamental metabolite Any metabolite produced by all living cells. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-D-ribose (CHEBI:47002) is a D-ribofuranose (CHEBI:47013) |
| β-D-ribose (CHEBI:47002) is enantiomer of β-L-ribose (CHEBI:47005) |
| Incoming Relation(s) |
| 5-azacytidine (CHEBI:2038) has functional parent β-D-ribose (CHEBI:47002) |
| nebularine (CHEBI:18255) has functional parent β-D-ribose (CHEBI:47002) |
| pirazofurin (CHEBI:90284) has functional parent β-D-ribose (CHEBI:47002) |
| tiazofurine (CHEBI:90239) has functional parent β-D-ribose (CHEBI:47002) |
| β-L-ribose (CHEBI:47005) is enantiomer of β-D-ribose (CHEBI:47002) |
| IUPAC Name |
|---|
| β-D-ribofuranose |
| Synonyms | Source |
|---|---|
| BETA-D-RIBOFURANOSYL | PDBeChem |
| β-D-Rib | JCBN |
| UniProt Name | Source |
|---|---|
| β-D-ribofuranose | UniProt |