EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H12N4O5 |
| Net Charge | 0 |
| Average Mass | 244.207 |
| Monoisotopic Mass | 244.08077 |
| SMILES | Nc1ncn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c(=O)n1 |
| InChI | InChI=1S/C8H12N4O5/c9-7-10-2-12(8(16)11-7)6-5(15)4(14)3(1-13)17-6/h2-6,13-15H,1H2,(H2,9,11,16)/t3-,4-,5-,6-/m1/s1 |
| InChIKey | NMUSYJAQQFHJEW-KVTDHHQDSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| Applications: | renoprotective agent Any compound that is able to prevent damage to the kidneys. antifibrotic agent Any agent which acts to reduce fibrosis. anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-azacytidine (CHEBI:2038) has functional parent β-D-ribose (CHEBI:47002) |
| 5-azacytidine (CHEBI:2038) has role anti-anaemic agent (CHEBI:75835) |
| 5-azacytidine (CHEBI:2038) has role antifibrotic agent (CHEBI:233423) |
| 5-azacytidine (CHEBI:2038) has role antineoplastic agent (CHEBI:35610) |
| 5-azacytidine (CHEBI:2038) has role antitubercular agent (CHEBI:33231) |
| 5-azacytidine (CHEBI:2038) has role renoprotective agent (CHEBI:231911) |
| 5-azacytidine (CHEBI:2038) is a N-glycosyl-1,3,5-triazine (CHEBI:48009) |
| 5-azacytidine (CHEBI:2038) is a nucleoside analogue (CHEBI:60783) |
| IUPAC Names |
|---|
| 4-amino-1-β-D-ribofuranosyl-1,3,5-triazin-2(1H)-one |
| 5-azacytidine |
| INNs | Source |
|---|---|
| azacitidina | ChemIDplus |
| azacitidinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 4-Amino-1-beta-D-ribofuranosyl-s-triazin-2(1H)-one | ChemIDplus |
| 5-azacitidine | ChEMBL |
| 5-Azacytidine | KEGG COMPOUND |
| azacitidine | ChEMBL |
| Azacitidine | KEGG COMPOUND |
| NSC-102816 | ChEMBL |
| Brand Names | Source |
|---|---|
| Azacitidine accord | ChEMBL |
| Azacitidine betapharm | ChEMBL |
| Azacitidine celgene | ChEMBL |
| Azacitidine kabi | ChEMBL |
| Azacitidine mylan | ChEMBL |
| Onureg | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 25 | DrugCentral |
| Azacitidine | Wikipedia |
| C11262 | KEGG COMPOUND |
| D03021 | KEGG DRUG |
| DB00928 | DrugBank |
| HMDB0015063 | HMDB |
| KR20140069225 | Patent |
| LSM-5218 | LINCS |
| US2015038444 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:620461 | Reaxys |
| CAS:320-67-2 | ChemIDplus |
| CAS:320-67-2 | KEGG COMPOUND |
| Citations |
|---|