EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:2038 - 5-azacytidine
| Formula | C8H12N4O5 |
| Net Charge | 0 |
| Average Mass | 244.207 |
| Monoisotopic Mass | 244.08077 |
| SMILES | Nc1ncn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c(=O)n1 |
| InChI | InChI=1S/C8H12N4O5/c9-7-10-2-12(8(16)11-7)6-5(15)4(14)3(1-13)17-6/h2-6,13-15H,1H2,(H2,9,11,16)/t3-,4-,5-,6-/m1/s1 |
| InChIKey | NMUSYJAQQFHJEW-KVTDHHQDSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| Applications: | anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. antifibrotic agent Any agent which acts to reduce fibrosis. renoprotective agent Any compound that is able to prevent damage to the kidneys. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-azacytidine (CHEBI:2038) has functional parent β-D-ribose (CHEBI:47002) |
| 5-azacytidine (CHEBI:2038) has role anti-anaemic agent (CHEBI:75835) |
| 5-azacytidine (CHEBI:2038) has role antifibrotic agent (CHEBI:233423) |
| 5-azacytidine (CHEBI:2038) has role antineoplastic agent (CHEBI:35610) |
| 5-azacytidine (CHEBI:2038) has role antitubercular agent (CHEBI:33231) |
| 5-azacytidine (CHEBI:2038) has role renoprotective agent (CHEBI:231911) |
| 5-azacytidine (CHEBI:2038) is a N-glycosyl-1,3,5-triazine (CHEBI:48009) |
| 5-azacytidine (CHEBI:2038) is a nucleoside analogue (CHEBI:60783) |
| IUPAC Names |
|---|
| 4-amino-1-β-D-ribofuranosyl-1,3,5-triazin-2(1H)-one |
| 5-azacytidine |
| INNs | Source |
|---|---|
| azacitidina | ChemIDplus |
| azacitidinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 4-Amino-1-beta-D-ribofuranosyl-s-triazin-2(1H)-one | ChemIDplus |
| 5-azacitidine | ChEMBL |
| 5-Azacytidine | KEGG COMPOUND |
| azacitidine | ChEMBL |
| Azacitidine | KEGG COMPOUND |
| NSC-102816 | ChEMBL |
| Brand Names | Source |
|---|---|
| Azacitidine accord | ChEMBL |
| Azacitidine betapharm | ChEMBL |
| Azacitidine celgene | ChEMBL |
| Azacitidine kabi | ChEMBL |
| Azacitidine mylan | ChEMBL |
| Onureg | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 25 | DrugCentral |
| Azacitidine | Wikipedia |
| C11262 | KEGG COMPOUND |
| D03021 | KEGG DRUG |
| DB00928 | DrugBank |
| HMDB0015063 | HMDB |
| KR20140069225 | Patent |
| LSM-5218 | LINCS |
| US2015038444 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:620461 | Reaxys |
| CAS:320-67-2 | ChemIDplus |
| CAS:320-67-2 | KEGG COMPOUND |
| Citations |
|---|