EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:90284 - pirazofurin
| Formula | C9H13N3O6 |
| Net Charge | 0 |
| Average Mass | 259.218 |
| Monoisotopic Mass | 259.08044 |
| SMILES | NC(=O)c1nnc([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c1O |
| InChI | InChI=1S/C9H13N3O6/c10-9(17)4-6(15)3(11-12-4)8-7(16)5(14)2(1-13)18-8/h2,5,7-8,13-16H,1H2,(H2,10,17)(H,11,12)/t2-,5-,7-,8+/m1/s1 |
| InChIKey | XESARGFCSKSFID-FLLFQEBCSA-N |
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. EC 4.1.1.23 (orotidine-5'-phosphate decarboxylase) inhibitor Any EC 4.1.1.* (carboxy-lyase) inhibitor that interferes with the action of orotidine-5'-phosphate decarboxylase (EC 4.1.1.23). antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pirazofurin (CHEBI:90284) has functional parent β-D-ribose (CHEBI:47002) |
| pirazofurin (CHEBI:90284) has role antimetabolite (CHEBI:35221) |
| pirazofurin (CHEBI:90284) has role antimicrobial agent (CHEBI:33281) |
| pirazofurin (CHEBI:90284) has role antineoplastic agent (CHEBI:35610) |
| pirazofurin (CHEBI:90284) has role EC 4.1.1.23 (orotidine-5'-phosphate decarboxylase) inhibitor (CHEBI:90285) |
| pirazofurin (CHEBI:90284) is a C-glycosyl compound (CHEBI:20857) |
| pirazofurin (CHEBI:90284) is a pyrazoles (CHEBI:26410) |
| IUPAC Name |
|---|
| (1S)-1,4-anhydro-1-(5-carbamoyl-4-hydroxy-1H-pyrazol-3-yl)-D-ribitol |
| INNs | Source |
|---|---|
| pirazofurina | WHO MedNet |
| pirazofurin | WHO MedNet |
| pirazofurine | WHO MedNet |
| pirazofurinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 3-(β-D-ribofuranosyl)-4-hydroxypyrazole-5-carboxamide | ChEBI |
| 4-hydroxy-3-(β-D-ribofuranosyl)-1H-pyrazole-5-carboxamide | ChEBI |
| 4-hydroxy-3-β-D-ribofuranosylpyrazole-5-carboxamide | ChemIDplus |
| PF | ChEBI |
| Antibiotic A 23813 | ChemIDplus |
| 4-hydroxy-3-β-D-ribofuranosyl-1H-pyrazole-5-carboxamide | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D05658 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:827736 | Reaxys |
| CAS:30868-30-5 | ChemIDplus |
| Citations |
|---|