EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H12N2O5S |
| Net Charge | 0 |
| Average Mass | 260.271 |
| Monoisotopic Mass | 260.04669 |
| SMILES | NC(=O)c1csc([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)n1 |
| InChI | InChI=1S/C9H12N2O5S/c10-8(15)3-2-17-9(11-3)7-6(14)5(13)4(1-12)16-7/h2,4-7,12-14H,1H2,(H2,10,15)/t4-,5-,6-,7-/m1/s1 |
| InChIKey | FVRDYQYEVDDKCR-DBRKOABJSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 1.1.1.205 (IMP dehydrogenase) inhibitor An EC 1.1.1.* (oxidoreductase acting on donor CH-OH group, NAD+ or NADP+ acceptor) inhibitor that interferes with the action of IMP dehydrogenase (EC 1.1.1.205), so blocking de novo biosynthesis of purine nucleotides. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tiazofurine (CHEBI:90239) has functional parent β-D-ribose (CHEBI:47002) |
| tiazofurine (CHEBI:90239) has role antineoplastic agent (CHEBI:35610) |
| tiazofurine (CHEBI:90239) has role EC 1.1.1.205 (IMP dehydrogenase) inhibitor (CHEBI:53746) |
| tiazofurine (CHEBI:90239) has role prodrug (CHEBI:50266) |
| tiazofurine (CHEBI:90239) is a C-glycosyl compound (CHEBI:20857) |
| tiazofurine (CHEBI:90239) is a 1,3-thiazoles (CHEBI:38418) |
| tiazofurine (CHEBI:90239) is a monocarboxylic acid amide (CHEBI:29347) |
| IUPAC Name |
|---|
| (1R)-1,4-anhydro-1-(4-carbamoyl-1,3-thiazol-2-yl)-D-ribitol |
| INNs | Source |
|---|---|
| tiazofurinum | WHO MedNet |
| tiazofurine | WHO MedNet |
| tiazofurine | WHO MedNet |
| tiazofurina | WHO MedNet |
| Synonyms | Source |
|---|---|
| 2-β-D-ribofuranosyl-4-thiazolecarboxamide | ChemIDplus |
| TCAR | ChEBI |
| CI-909 | ChemIDplus |
| 2-(β-D-ribofuranosyl)-4-thiazolecarboxamide | ChEBI |
| riboxamide | ChemIDplus |
| tiazofurin | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D06130 | KEGG DRUG |
| TIZ | PDBeChem |
| Tiazofurin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1084555 | Reaxys |
| CAS:60084-10-8 | ChemIDplus |
| Citations |
|---|