EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H34O |
| Net Charge | 0 |
| Average Mass | 290.491 |
| Monoisotopic Mass | 290.26097 |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CO |
| InChI | InChI=1S/C20H34O/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-14-20(5)15-16-21/h9,11,13,15,21H,6-8,10,12,14,16H2,1-5H3/b18-11+,19-13+,20-15+ |
| InChIKey | OJISWRZIEWCUBN-QIRCYJPOSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. |
| Application: | antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (E,E,E)-geranylgeraniol (CHEBI:46762) is a geranylgeraniol (CHEBI:24229) |
| Incoming Relation(s) |
| (2E,6E,10E)-geranylgeranic acid (CHEBI:84971) has functional parent (E,E,E)-geranylgeraniol (CHEBI:46762) |
| geranylgeranyl acetate (CHEBI:229666) has functional parent (E,E,E)-geranylgeraniol (CHEBI:46762) |
| geranylgeranyl bacteriochlorophyllide a (CHEBI:91131) has functional parent (E,E,E)-geranylgeraniol (CHEBI:46762) |
| geranylgeranyl-chlorophyll a (CHEBI:64668) has functional parent (E,E,E)-geranylgeraniol (CHEBI:46762) |
| ω-hydroxygeranylgeraniol (CHEBI:83953) has functional parent (E,E,E)-geranylgeraniol (CHEBI:46762) |
| IUPAC Name |
|---|
| (2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraen-1-ol |
| Synonym | Source |
|---|---|
| Geranylgeraniol | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| (2E,6E,10E)-geranylgeraniol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00003428 | KNApSAcK |
| C09094 | KEGG COMPOUND |
| CPD-9087 | MetaCyc |
| Geranylgeraniol | Wikipedia |
| LMPR0104010009 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1913779 | Reaxys |
| CAS:24034-73-9 | KEGG COMPOUND |