EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H34O |
| Net Charge | 0 |
| Average Mass | 290.491 |
| Monoisotopic Mass | 290.26097 |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CO |
| InChI | InChI=1S/C20H34O/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-14-20(5)15-16-21/h9,11,13,15,21H,6-8,10,12,14,16H2,1-5H3/b18-11+,19-13+,20-15+ |
| InChIKey | OJISWRZIEWCUBN-QIRCYJPOSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (E,E,E)-geranylgeraniol (CHEBI:46762) is a geranylgeraniol (CHEBI:24229) |
| Incoming Relation(s) |
| (2E,6E,10E)-geranylgeranic acid (CHEBI:84971) has functional parent (E,E,E)-geranylgeraniol (CHEBI:46762) |
| geranylgeranyl acetate (CHEBI:229666) has functional parent (E,E,E)-geranylgeraniol (CHEBI:46762) |
| geranylgeranyl bacteriochlorophyllide a (CHEBI:91131) has functional parent (E,E,E)-geranylgeraniol (CHEBI:46762) |
| geranylgeranyl-chlorophyll a (CHEBI:64668) has functional parent (E,E,E)-geranylgeraniol (CHEBI:46762) |
| ω-hydroxygeranylgeraniol (CHEBI:83953) has functional parent (E,E,E)-geranylgeraniol (CHEBI:46762) |
| IUPAC Name |
|---|
| (2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraen-1-ol |
| Synonym | Source |
|---|---|
| Geranylgeraniol | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| (2E,6E,10E)-geranylgeraniol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00003428 | KNApSAcK |
| C09094 | KEGG COMPOUND |
| CPD-9087 | MetaCyc |
| Geranylgeraniol | Wikipedia |
| LMPR0104010009 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1913779 | Reaxys |
| CAS:24034-73-9 | KEGG COMPOUND |