EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C55H66MgN4O5 |
| Net Charge | 0 |
| Average Mass | 887.461 |
| Monoisotopic Mass | 886.48836 |
| SMILES | C=Cc1c(C)c2[n]3c1C=C1C(C)=C(CC)C4=[N+]1[Mg-2]31[n]3c(c(C)c5c3=C(C3=[N+]1C(=C2)[C@@H](C)[C@@H]3CCC(=O)OC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C)[C@@H](C(=O)OC)C5=O)=C4 |
| InChI | InChI=1S/C55H67N4O5.Mg/c1-13-39-35(8)42-28-44-37(10)41(24-25-48(60)64-27-26-34(7)23-17-22-33(6)21-16-20-32(5)19-15-18-31(3)4)52(58-44)50-51(55(62)63-12)54(61)49-38(11)45(59-53(49)50)30-47-40(14-2)36(9)43(57-47)29-46(39)56-42;/h13,18,20,22,26,28-30,37,41,51H,1,14-17,19,21,23-25,27H2,2-12H3,(H-,56,57,58,59,61);/q-1;+2/p-1/b32-20+,33-22+,34-26+;/t37-,41-,51+;/m0./s1 |
| InChIKey | DLGTYWBJNMHIPY-JYVCQAQSSA-M |
| Roles Classification |
|---|
| Biological Role: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| geranylgeranyl-chlorophyll a (CHEBI:64668) has functional parent (E,E,E)-geranylgeraniol (CHEBI:46762) |
| geranylgeranyl-chlorophyll a (CHEBI:64668) has functional parent chlorophyllide a (CHEBI:16900) |
| geranylgeranyl-chlorophyll a (CHEBI:64668) is a carboxylic ester (CHEBI:33308) |
| geranylgeranyl-chlorophyll a (CHEBI:64668) is a chlorophyll (CHEBI:28966) |
| IUPAC Name |
|---|
| [methyl (3S,4S,21R)-14-ethyl-4,8,13,18-tetramethyl-20-oxo-3-(3-oxo-3-{[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraen-1-yl]oxy}propyl)-9-vinylphorbine-21-carboxylatato(2−)-κ4N23,N24,N25,N26]magnesium |
| Synonyms | Source |
|---|---|
| geranylgeranyl-chl a | SUBMITTER |
| geranylgeranyl-chlorophyllide a | ChEBI |
| GG-chl a | SUBMITTER |
| GG-chlorophyll a | SUBMITTER |
| [methyl (3S,4S,21R)-14-ethyl-4,8,13,18-tetramethyl-20-oxo-3-(3-oxo-3-{[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraen-1-yl]oxy}propyl)-9-vinylphorbine-21-carboxylatato(2−)-κ4N,N']magnesium | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-7005 | MetaCyc |
| Citations |
|---|