EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H34O |
| Net Charge | 0 |
| Average Mass | 290.491 |
| Monoisotopic Mass | 290.26097 |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCO |
| InChI | InChI=1S/C20H34O/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-14-20(5)15-16-21/h9,11,13,15,21H,6-8,10,12,14,16H2,1-5H3 |
| InChIKey | OJISWRZIEWCUBN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. |
| Application: | antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| geranylgeraniol (CHEBI:24229) has role antileishmanial agent (CHEBI:70868) |
| geranylgeraniol (CHEBI:24229) has role plant metabolite (CHEBI:76924) |
| geranylgeraniol (CHEBI:24229) has role volatile oil component (CHEBI:27311) |
| geranylgeraniol (CHEBI:24229) is a diterpenoid (CHEBI:23849) |
| geranylgeraniol (CHEBI:24229) is a polyprenol (CHEBI:26199) |
| Incoming Relation(s) |
| (E,E,E)-geranylgeraniol (CHEBI:46762) is a geranylgeraniol (CHEBI:24229) |
| (Z,Z,Z)-geranylgeraniol (CHEBI:18822) is a geranylgeraniol (CHEBI:24229) |
| IUPAC Name |
|---|
| 3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraen-1-ol |
| Citations |
|---|