EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:24229 - geranylgeraniol
| Formula | C20H34O |
| Net Charge | 0 |
| Average Mass | 290.491 |
| Monoisotopic Mass | 290.26097 |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCO |
| InChI | InChI=1S/C20H34O/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-14-20(5)15-16-21/h9,11,13,15,21H,6-8,10,12,14,16H2,1-5H3 |
| InChIKey | OJISWRZIEWCUBN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| geranylgeraniol (CHEBI:24229) has role antileishmanial agent (CHEBI:70868) |
| geranylgeraniol (CHEBI:24229) has role plant metabolite (CHEBI:76924) |
| geranylgeraniol (CHEBI:24229) has role volatile oil component (CHEBI:27311) |
| geranylgeraniol (CHEBI:24229) is a diterpenoid (CHEBI:23849) |
| geranylgeraniol (CHEBI:24229) is a polyprenol (CHEBI:26199) |
| Incoming Relation(s) |
| (E,E,E)-geranylgeraniol (CHEBI:46762) is a geranylgeraniol (CHEBI:24229) |
| (Z,Z,Z)-geranylgeraniol (CHEBI:18822) is a geranylgeraniol (CHEBI:24229) |
| IUPAC Name |
|---|
| 3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraen-1-ol |
| Citations |
|---|