EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H36O2 |
| Net Charge | 0 |
| Average Mass | 332.528 |
| Monoisotopic Mass | 332.27153 |
| SMILES | CC(=O)OC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C22H36O2/c1-18(2)10-7-11-19(3)12-8-13-20(4)14-9-15-21(5)16-17-24-22(6)23/h10,12,14,16H,7-9,11,13,15,17H2,1-6H3/b19-12+,20-14+,21-16+ |
| InChIKey | NHYSRKKHKHCRGR-RFRQLJORSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bombus cullumanus (ncbitaxon:2562068) | - | PubMed (17193334) | Found in cephalic labial gland secretion. |
| Bombus semenoviellus (ncbitaxon:395561) | - | PubMed (17193334) | Found in cephalic labial gland secretion. |
| Nannotrigona testaceicornis (ncbitaxon:166427) | - | PubMed (11382068) | Found in dufour gland secretion. |
| Roles Classification |
|---|
| Biological Roles: | pheromone A semiochemical used in olfactory communication between organisms of the same species eliciting a change in sexual or social behaviour. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| geranylgeranyl acetate (CHEBI:229666) has functional parent (E,E,E)-geranylgeraniol (CHEBI:46762) |
| geranylgeranyl acetate (CHEBI:229666) has role antibacterial agent (CHEBI:33282) |
| geranylgeranyl acetate (CHEBI:229666) has role pheromone (CHEBI:26013) |
| geranylgeranyl acetate (CHEBI:229666) is a acetate ester (CHEBI:47622) |
| IUPAC Name |
|---|
| (2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraen-1-yl acetate |
| Synonyms | Source |
|---|---|
| (2E,6E,10E)-3,7,11,15-tetramethyl-2,6,10,14-hexadecatetraenyl acetate | NIST Chemistry WebBook |
| 3,7,11,15-tetramethyl-2E,6E,10E,14-hexadecatetraenyl acetate | LIPID MAPS |
| all-trans-geranylgeranyl acetate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA07010351 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:61691-98-3 | NIST Chemistry WebBook |
| Citations |
|---|