EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H21NO3 |
| Net Charge | 0 |
| Average Mass | 287.359 |
| Monoisotopic Mass | 287.15214 |
| SMILES | [H][C@@]12CC[C@H](O)[C@@H]3Oc4c(O)ccc5c4[C@@]31CCN(C)[C@@H]2C5 |
| InChI | InChI=1S/C17H21NO3/c1-18-7-6-17-10-3-5-13(20)16(17)21-15-12(19)4-2-9(14(15)17)8-11(10)18/h2,4,10-11,13,16,19-20H,3,5-8H2,1H3/t10-,11+,13-,16-,17-/m0/s1 |
| InChIKey | IJVCSMSMFSCRME-KBQPJGBKSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dihydromorphine (CHEBI:4575) is a morphinane alkaloid (CHEBI:25418) |
| Incoming Relation(s) |
| 6-AcMorHap (CHEBI:234596) has functional parent dihydromorphine (CHEBI:4575) |
| 6-PrOxyHap (CHEBI:234597) has functional parent dihydromorphine (CHEBI:4575) |
| DiAmHap (CHEBI:234598) has functional parent dihydromorphine (CHEBI:4575) |
| DiPrOxyHap (CHEBI:234599) has functional parent dihydromorphine (CHEBI:4575) |
| Synonym | Source |
|---|---|
| Dihydromorphine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C11782 | KEGG COMPOUND |
| HMDB0060929 | HMDB |
| HMDB0060548 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:509-60-4 | KEGG COMPOUND |