EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C41H42N2O4S |
| Net Charge | 0 |
| Average Mass | 658.864 |
| Monoisotopic Mass | 658.28653 |
| SMILES | [H][C@@]12CC[C@H](OC(C)=O)[C@@H]3Oc4c(NC(=O)CCSC(c5ccccc5)(c5ccccc5)c5ccccc5)ccc5c4[C@@]31CCN(C)[C@@H]2C5 |
| InChI | InChI=1S/C41H42N2O4S/c1-27(44)46-35-21-19-32-34-26-28-18-20-33(38-37(28)40(32,39(35)47-38)23-24-43(34)2)42-36(45)22-25-48-41(29-12-6-3-7-13-29,30-14-8-4-9-15-30)31-16-10-5-11-17-31/h3-18,20,32,34-35,39H,19,21-26H2,1-2H3,(H,42,45)/t32-,34+,35-,39-,40-/m0/s1 |
| InChIKey | CURATZKXWRNFSM-JKDLXNOFSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-AcMorHap (CHEBI:234596) has functional parent dihydromorphine (CHEBI:4575) |
| 6-AcMorHap (CHEBI:234596) has role hapten (CHEBI:59174) |
| 6-AcMorHap (CHEBI:234596) is a acetate ester (CHEBI:47622) |
| 6-AcMorHap (CHEBI:234596) is a benzenes (CHEBI:22712) |
| 6-AcMorHap (CHEBI:234596) is a morphinane alkaloid (CHEBI:25418) |
| 6-AcMorHap (CHEBI:234596) is a organic heteropentacyclic compound (CHEBI:38164) |
| 6-AcMorHap (CHEBI:234596) is a organic sulfide (CHEBI:16385) |
| 6-AcMorHap (CHEBI:234596) is a secondary carboxamide (CHEBI:140325) |
| 6-AcMorHap (CHEBI:234596) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 17-methyl-3-{3-[(triphenylmethyl)sulfanyl]propanamido}-5α-4,5-epoxymorphinan-6α-yl acetate |
| Citations |
|---|