EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C48H54N2O4S |
| Net Charge | 0 |
| Average Mass | 755.037 |
| Monoisotopic Mass | 754.38043 |
| SMILES | [H][C@@]12CC[C@H](CC(C)=O)[C@@H]3Oc4c(CC(C)=O)ccc5c4[C@@]31CCN(CCCCNC(=O)CCSC(c1ccccc1)(c1ccccc1)c1ccccc1)[C@@H]2C5 |
| InChI | InChI=1S/C48H54N2O4S/c1-33(51)30-36-21-20-35-32-42-41-23-22-37(31-34(2)52)46-47(41,44(35)45(36)54-46)25-28-50(42)27-13-12-26-49-43(53)24-29-55-48(38-14-6-3-7-15-38,39-16-8-4-9-17-39)40-18-10-5-11-19-40/h3-11,14-21,37,41-42,46H,12-13,22-32H2,1-2H3,(H,49,53)/t37-,41+,42-,46+,47+/m1/s1 |
| InChIKey | NZRVKNDTHZGTQX-VUOLTNFASA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| DiPrOxyHap (CHEBI:234599) has functional parent dihydromorphine (CHEBI:4575) |
| DiPrOxyHap (CHEBI:234599) has role hapten (CHEBI:59174) |
| DiPrOxyHap (CHEBI:234599) is a benzenes (CHEBI:22712) |
| DiPrOxyHap (CHEBI:234599) is a diketone (CHEBI:46640) |
| DiPrOxyHap (CHEBI:234599) is a methyl ketone (CHEBI:51867) |
| DiPrOxyHap (CHEBI:234599) is a morphinane alkaloid (CHEBI:25418) |
| DiPrOxyHap (CHEBI:234599) is a organic heteropentacyclic compound (CHEBI:38164) |
| DiPrOxyHap (CHEBI:234599) is a organic sulfide (CHEBI:16385) |
| DiPrOxyHap (CHEBI:234599) is a secondary carboxamide (CHEBI:140325) |
| DiPrOxyHap (CHEBI:234599) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| N-{4-[3,6α-bis(2-oxopropyl)-5α-4,5-epoxymorphinan-17-yl]butyl}-3-[(triphenylmethyl)sulfanyl]propanamide |
| Citations |
|---|