EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C46H52N4O4S |
| Net Charge | 0 |
| Average Mass | 757.013 |
| Monoisotopic Mass | 756.37093 |
| SMILES | [H][C@@]12CC[C@H](NC(C)=O)[C@@H]3Oc4c(NC(C)=O)ccc5c4[C@@]31CCN(CCCCNC(=O)CCSC(c1ccccc1)(c1ccccc1)c1ccccc1)[C@@H]2C5 |
| InChI | InChI=1S/C46H52N4O4S/c1-31(51)48-38-22-20-33-30-40-37-21-23-39(49-32(2)52)44-45(37,42(33)43(38)54-44)25-28-50(40)27-13-12-26-47-41(53)24-29-55-46(34-14-6-3-7-15-34,35-16-8-4-9-17-35)36-18-10-5-11-19-36/h3-11,14-20,22,37,39-40,44H,12-13,21,23-30H2,1-2H3,(H,47,53)(H,48,51)(H,49,52)/t37-,39-,40+,44-,45-/m0/s1 |
| InChIKey | UNTMJXHOWSADLJ-NAPMIUROSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| DiAmHap (CHEBI:234598) has functional parent dihydromorphine (CHEBI:4575) |
| DiAmHap (CHEBI:234598) has role hapten (CHEBI:59174) |
| DiAmHap (CHEBI:234598) is a acetamides (CHEBI:22160) |
| DiAmHap (CHEBI:234598) is a benzenes (CHEBI:22712) |
| DiAmHap (CHEBI:234598) is a morphinane alkaloid (CHEBI:25418) |
| DiAmHap (CHEBI:234598) is a organic heteropentacyclic compound (CHEBI:38164) |
| DiAmHap (CHEBI:234598) is a organic sulfide (CHEBI:16385) |
| DiAmHap (CHEBI:234598) is a secondary carboxamide (CHEBI:140325) |
| DiAmHap (CHEBI:234598) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| N-[4-(3,6α-diacetamido-5α-4,5-epoxymorphinan-17-yl)butyl]-3-[(triphenylmethyl)sulfanyl]propanamide |
| Citations |
|---|