EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:4515 - dicyclomine hydrochloride
| Formula | C19H36NO2.Cl |
| Net Charge | 0 |
| Average Mass | 345.955 |
| Monoisotopic Mass | 345.24346 |
| SMILES | CC[NH+](CC)CCOC(=O)C1(C2CCCCC2)CCCCC1.[Cl-] |
| InChI | InChI=1S/C19H35NO2.ClH/c1-3-20(4-2)15-16-22-18(21)19(13-9-6-10-14-19)17-11-7-5-8-12-17;/h17H,3-16H2,1-2H3;1H |
| InChIKey | GUBNMFJOJGDCEL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Applications: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dicyclomine hydrochloride (CHEBI:4515) has part dicyclomine (CHEBI:4514) |
| dicyclomine hydrochloride (CHEBI:4515) has role antispasmodic drug (CHEBI:53784) |
| dicyclomine hydrochloride (CHEBI:4515) has role muscarinic antagonist (CHEBI:48876) |
| dicyclomine hydrochloride (CHEBI:4515) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 2-{[1,1'-bi(cyclohexyl)-1-ylcarbonyl]oxy}-N,N-diethylethanaminium chloride |
| Synonyms | Source |
|---|---|
| 2-(diethylamino)ethyl 1,1'-bi(cyclohexyl)-1-carboxylate hydrochloride | IUPAC |
| 2-diethylaminoethyl bicyclohexyl-1-carboxylate hydrochloride | ChemIDplus |
| 2-(diethylamino)ethyl (bicyclohexyl)-1-carboxylate hydrochloride | ChemIDplus |
| (bicyclohexyl)-1-carboxylic acid, 2-(diethylamino)ethyl ester, hydrochloride | ChemIDplus |
| dicyclomine HCl | ChemIDplus |
| dicycloverin HCl | ChemIDplus |