EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:4515 - dicyclomine hydrochloride
| Formula | C19H36NO2.Cl |
| Net Charge | 0 |
| Average Mass | 345.955 |
| Monoisotopic Mass | 345.24346 |
| SMILES | CC[NH+](CC)CCOC(=O)C1(C2CCCCC2)CCCCC1.[Cl-] |
| InChI | InChI=1S/C19H35NO2.ClH/c1-3-20(4-2)15-16-22-18(21)19(13-9-6-10-14-19)17-11-7-5-8-12-17;/h17H,3-16H2,1-2H3;1H |
| InChIKey | GUBNMFJOJGDCEL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Applications: | antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dicyclomine hydrochloride (CHEBI:4515) has part dicyclomine (CHEBI:4514) |
| dicyclomine hydrochloride (CHEBI:4515) has role antispasmodic drug (CHEBI:53784) |
| dicyclomine hydrochloride (CHEBI:4515) has role muscarinic antagonist (CHEBI:48876) |
| dicyclomine hydrochloride (CHEBI:4515) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 2-{[1,1'-bi(cyclohexyl)-1-ylcarbonyl]oxy}-N,N-diethylethanaminium chloride |
| Synonyms | Source |
|---|---|
| 2-diethylaminoethyl bicyclohexyl-1-carboxylate hydrochloride | ChemIDplus |
| dicycloverin hydrochloride | ChemIDplus |
| (bicyclohexyl)-1-carboxylic acid, 2-(diethylamino)ethyl ester, hydrochloride | ChemIDplus |
| 2-(diethylamino)ethyl (bicyclohexyl)-1-carboxylate hydrochloride | ChemIDplus |
| dicycloverin HCl | ChemIDplus |
| dicyclomine HCl | ChemIDplus |