EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H22O2 |
| Net Charge | 0 |
| Average Mass | 210.317 |
| Monoisotopic Mass | 210.16198 |
| SMILES | O=C(O)C1(C2CCCCC2)CCCCC1 |
| InChI | InChI=1S/C13H22O2/c14-12(15)13(9-5-2-6-10-13)11-7-3-1-4-8-11/h11H,1-10H2,(H,14,15) |
| InChIKey | SJSRFXJWBKOROD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,1'-bi(cyclohexyl)-1-carboxylic acid (CHEBI:59738) is a monocarboxylic acid (CHEBI:25384) |
| Incoming Relation(s) |
| dicyclomine (CHEBI:4514) has functional parent 1,1'-bi(cyclohexyl)-1-carboxylic acid (CHEBI:59738) |
| IUPAC Name |
|---|
| 1,1'-bi(cyclohexyl)-1-carboxylic acid |
| Synonym | Source |
|---|---|
| (1,1'-bicyclohexyl)-1-carboxylic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2098213 | Beilstein |
| CAS:60263-54-9 | ChemIDplus |