EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:44962 - D-α-phenylglycine
| Formula | C8H9NO2 |
| Net Charge | 0 |
| Average Mass | 151.165 |
| Monoisotopic Mass | 151.06333 |
| SMILES | N[C@@H](C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C8H9NO2/c9-7(8(10)11)6-4-2-1-3-5-6/h1-5,7H,9H2,(H,10,11)/t7-/m1/s1 |
| InChIKey | ZGUNAGUHMKGQNY-SSDOTTSWSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-α-phenylglycine (CHEBI:44962) is a α-phenylglycine (CHEBI:55484) |
| D-α-phenylglycine (CHEBI:44962) is enantiomer of L-α-phenylglycine (CHEBI:439819) |
| D-α-phenylglycine (CHEBI:44962) is tautomer of D-α-phenylglycine zwitterion (CHEBI:77399) |
| Incoming Relation(s) |
| N-carbamoyl-D-phenylglycine (CHEBI:141249) has functional parent D-α-phenylglycine (CHEBI:44962) |
| N-carbamoyl-D-phenylglycine(1−) (CHEBI:140758) has functional parent D-α-phenylglycine (CHEBI:44962) |
| L-α-phenylglycine (CHEBI:439819) is enantiomer of D-α-phenylglycine (CHEBI:44962) |
| D-α-phenylglycine zwitterion (CHEBI:77399) is tautomer of D-α-phenylglycine (CHEBI:44962) |
| IUPAC Name |
|---|
| (2R)-amino(phenyl)acetic acid |
| Synonyms | Source |
|---|---|
| D-(-)-alpha-Phenylglycine | ChemIDplus |
| D-PHENYLGLYCINE | PDBeChem |
| (R)-phenylglycine | ChEMBL |
| Citations |
|---|