EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10N2O3 |
| Net Charge | 0 |
| Average Mass | 194.190 |
| Monoisotopic Mass | 194.06914 |
| SMILES | NC(=O)N[C@@H](C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C9H10N2O3/c10-9(14)11-7(8(12)13)6-4-2-1-3-5-6/h1-5,7H,(H,12,13)(H3,10,11,14)/t7-/m1/s1 |
| InChIKey | GIOUOHDKHHZWIQ-SSDOTTSWSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-carbamoyl-D-phenylglycine (CHEBI:141249) has functional parent N-carbamoylglycine (CHEBI:133351) |
| N-carbamoyl-D-phenylglycine (CHEBI:141249) has functional parent D-α-phenylglycine (CHEBI:44962) |
| N-carbamoyl-D-phenylglycine (CHEBI:141249) is a monocarboxylic acid (CHEBI:25384) |
| N-carbamoyl-D-phenylglycine (CHEBI:141249) is a ureas (CHEBI:47857) |
| N-carbamoyl-D-phenylglycine (CHEBI:141249) is conjugate acid of N-carbamoyl-D-phenylglycine(1−) (CHEBI:140758) |
| Incoming Relation(s) |
| N-carbamoyl-D-phenylglycine(1−) (CHEBI:140758) is conjugate base of N-carbamoyl-D-phenylglycine (CHEBI:141249) |
| IUPAC Name |
|---|
| (2R)-(carbamoylamino)(phenyl)acetic acid |
| Synonyms | Source |
|---|---|
| (R)-α-[(aminocarbonyl)amino]benzeneacetic acid | ChemIDplus |
| (2R)-2-(carbamoylamino)-2-phenylacetic acid | ChEBI |
| D-(−)-N-carbamoyl phenylglycine | ChEBI |
| (−)-N-carbamoyl-D-phenylglycine | ChEBI |
| D-(−)-N-carbamoyl-phenylglycine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3133932 | Reaxys |
| CAS:6489-76-5 | ChemIDplus |
| Citations |
|---|