EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H9N2O3 |
| Net Charge | -1 |
| Average Mass | 193.182 |
| Monoisotopic Mass | 193.06187 |
| SMILES | NC(=O)N[C@@H](C(=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C9H10N2O3/c10-9(14)11-7(8(12)13)6-4-2-1-3-5-6/h1-5,7H,(H,12,13)(H3,10,11,14)/p-1/t7-/m1/s1 |
| InChIKey | GIOUOHDKHHZWIQ-SSDOTTSWSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-carbamoyl-D-phenylglycine(1−) (CHEBI:140758) has functional parent D-α-phenylglycine (CHEBI:44962) |
| N-carbamoyl-D-phenylglycine(1−) (CHEBI:140758) is a monocarboxylic acid anion (CHEBI:35757) |
| N-carbamoyl-D-phenylglycine(1−) (CHEBI:140758) is conjugate base of N-carbamoyl-D-phenylglycine (CHEBI:141249) |
| Incoming Relation(s) |
| N-carbamoyl-D-phenylglycine (CHEBI:141249) is conjugate acid of N-carbamoyl-D-phenylglycine(1−) (CHEBI:140758) |
| UniProt Name | Source |
|---|---|
| N-carbamoyl-D-phenylglycine | UniProt |
| Citations |
|---|