EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H9NO2 |
| Net Charge | 0 |
| Average Mass | 151.165 |
| Monoisotopic Mass | 151.06333 |
| SMILES | [NH3+][C@@H](C(=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C8H9NO2/c9-7(8(10)11)6-4-2-1-3-5-6/h1-5,7H,9H2,(H,10,11)/t7-/m1/s1 |
| InChIKey | ZGUNAGUHMKGQNY-SSDOTTSWSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-α-phenylglycine zwitterion (CHEBI:77399) is a D-α-amino acid zwitterion (CHEBI:59871) |
| D-α-phenylglycine zwitterion (CHEBI:77399) is tautomer of D-α-phenylglycine (CHEBI:44962) |
| Incoming Relation(s) |
| D-α-phenylglycine (CHEBI:44962) is tautomer of D-α-phenylglycine zwitterion (CHEBI:77399) |
| IUPAC Name |
|---|
| (2R)-azaniumyl(phenyl)acetate |
| Synonyms | Source |
|---|---|
| (2R)-ammonio(phenyl)acetate | IUPAC |
| (R)-2-amino-2-phenylacetic acid zwitterion | ChEBI |
| (R)-phenylglycine zwitterion | SUBMITTER |
| (D)-phenylglycine zwitterion | SUBMITTER |
| UniProt Name | Source |
|---|---|
| D-α-phenylglycine | UniProt |