EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:439819 - L-α-phenylglycine
| Formula | C8H9NO2 |
| Net Charge | 0 |
| Average Mass | 151.165 |
| Monoisotopic Mass | 151.06333 |
| SMILES | N[C@H](C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C8H9NO2/c9-7(8(10)11)6-4-2-1-3-5-6/h1-5,7H,9H2,(H,10,11)/t7-/m0/s1 |
| InChIKey | ZGUNAGUHMKGQNY-ZETCQYMHSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-α-phenylglycine (CHEBI:439819) is a α-phenylglycine (CHEBI:55484) |
| L-α-phenylglycine (CHEBI:439819) is enantiomer of D-α-phenylglycine (CHEBI:44962) |
| L-α-phenylglycine (CHEBI:439819) is tautomer of L-α-phenylglycine zwitterion (CHEBI:136765) |
| Incoming Relation(s) |
| (S)-3,5-dihydroxyphenylglycine (CHEBI:29474) has functional parent L-α-phenylglycine (CHEBI:439819) |
| N-acetyl-L-α-phenylglycine (CHEBI:137652) has functional parent L-α-phenylglycine (CHEBI:439819) |
| D-α-phenylglycine (CHEBI:44962) is enantiomer of L-α-phenylglycine (CHEBI:439819) |
| L-α-phenylglycine zwitterion (CHEBI:136765) is tautomer of L-α-phenylglycine (CHEBI:439819) |
| IUPAC Name |
|---|
| (2S)-amino(phenyl)acetic acid |
| Synonyms | Source |
|---|---|
| L-(+)-2-Phenylglycine | ChemIDplus |
| L-(+)-alpha-Aminophenylacetic acid | ChemIDplus |
| L-Phenylglycine | ChemIDplus |
| (alphaS)-alpha-aminobenzeneacetic acid | ChemIDplus |
| L-(+)-alpha-Phenylglycine | ChemIDplus |
| Phenylglycine | KEGG COMPOUND |