EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H18N5O7P |
| Net Charge | 0 |
| Average Mass | 375.278 |
| Monoisotopic Mass | 375.09438 |
| SMILES | CN(C)c1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C12H18N5O7P/c1-16(2)10-7-11(14-4-13-10)17(5-15-7)12-9(19)8(18)6(24-12)3-23-25(20,21)22/h4-6,8-9,12,18-19H,3H2,1-2H3,(H2,20,21,22)/t6-,8-,9-,12-/m1/s1 |
| InChIKey | OWRDTHWSVNWFAZ-WOUKDFQISA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N6,N6-dimethyl-AMP (CHEBI:43986) has functional parent adenosine 5'-monophosphate (CHEBI:16027) |
| N6,N6-dimethyl-AMP (CHEBI:43986) is a purine ribonucleoside 5'-monophosphate (CHEBI:37021) |
| N6,N6-dimethyl-AMP (CHEBI:43986) is conjugate acid of N6,N6-dimethyl-AMP(2−) (CHEBI:235457) |
| Incoming Relation(s) |
| N6,N6-dimethyl-AMP(2−) (CHEBI:235457) is conjugate base of N6,N6-dimethyl-AMP (CHEBI:43986) |
| N6,N6-dimethyladenosine 5'-monophosphate residue (CHEBI:74744) is substituent group from N6,N6-dimethyl-AMP (CHEBI:43986) |
| IUPAC Name |
|---|
| N,N-dimethyladenosine 5'-(dihydrogen phosphate) |
| Synonyms | Source |
|---|---|
| 6N-DIMETHYLADENOSINE-5'-MONOPHOSHATE | PDBeChem |
| N6-dimethyl-AMP | ChEBI |
| N6-dimethyl AMP | ChEBI |
| N6,N6-dimethyl-[5']adenylic acid | ChEBI |
| N6,N6-Dimethyl-[5']adenylsäure | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| MA6 | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Beilstein:59646 | Beilstein |
| Citations |
|---|