EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H16N5O7P |
| Net Charge | -2 |
| Average Mass | 373.262 |
| Monoisotopic Mass | 373.07983 |
| SMILES | CN(C)c1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)([O-])[O-])[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C12H18N5O7P/c1-16(2)10-7-11(14-4-13-10)17(5-15-7)12-9(19)8(18)6(24-12)3-23-25(20,21)22/h4-6,8-9,12,18-19H,3H2,1-2H3,(H2,20,21,22)/p-2/t6-,8-,9-,12-/m1/s1 |
| InChIKey | OWRDTHWSVNWFAZ-WOUKDFQISA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N6,N6-dimethyl-AMP(2−) (CHEBI:235457) is a nucleoside 5'-monophosphate(2−) (CHEBI:58043) |
| N6,N6-dimethyl-AMP(2−) (CHEBI:235457) is conjugate base of N6,N6-dimethyl-AMP (CHEBI:43986) |
| Incoming Relation(s) |
| N6,N6-dimethyl-AMP (CHEBI:43986) is conjugate acid of N6,N6-dimethyl-AMP(2−) (CHEBI:235457) |
| UniProt Name | Source |
|---|---|
| N6,N6-dimethyl-AMP | UniProt |
| Citations |
|---|