EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H22N5O6P |
| Net Charge | 0 |
| Average Mass | 387.333 |
| Monoisotopic Mass | 387.13077 |
| SMILES | CO[C@H]1[C@@H](O)[C@H](n2cnc3c(N(C)C)ncnc32)O[C@@H]1COP(C)(=O)O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N6,N6-dimethyladenosine 5'-monophosphate residue (CHEBI:74744) is a nucleotide residue (CHEBI:50319) |
| N6,N6-dimethyladenosine 5'-monophosphate residue (CHEBI:74744) is conjugate acid of N6,N6-dimethyladenosine 5'-monophosphate(1−) residue (CHEBI:74493) |
| N6,N6-dimethyladenosine 5'-monophosphate residue (CHEBI:74744) is substituent group from N6,N6-dimethyl-AMP (CHEBI:43986) |
| Incoming Relation(s) |
| N6,N6-dimethyladenosine 5'-monophosphate(1−) residue (CHEBI:74493) is conjugate base of N6,N6-dimethyladenosine 5'-monophosphate residue (CHEBI:74744) |
| Synonyms | Source |
|---|---|
| N6,N6-dimethyl-AMP residue | ChEBI |
| N6,N6-dimethyladenosine 5'-phosphate residue | ChEBI |