EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H9NO4 |
| Net Charge | 0 |
| Average Mass | 183.163 |
| Monoisotopic Mass | 183.05316 |
| SMILES | N[C@H](C(=O)O)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C8H9NO4/c9-7(8(12)13)4-1-5(10)3-6(11)2-4/h1-3,7,10-11H,9H2,(H,12,13)/t7-/m0/s1 |
| InChIKey | HOOWCUZPEFNHDT-ZETCQYMHSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-3,5-dihydroxyphenylglycine (CHEBI:29474) has functional parent L-α-phenylglycine (CHEBI:439819) |
| (S)-3,5-dihydroxyphenylglycine (CHEBI:29474) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| (S)-3,5-dihydroxyphenylglycine (CHEBI:29474) is a resorcinols (CHEBI:33572) |
| (S)-3,5-dihydroxyphenylglycine (CHEBI:29474) is tautomer of (S)-3,5-dihydroxyphenylglycine zwitterion (CHEBI:75204) |
| Incoming Relation(s) |
| (S)-3,5-dihydroxyphenylglycine zwitterion (CHEBI:75204) is tautomer of (S)-3,5-dihydroxyphenylglycine (CHEBI:29474) |
| IUPAC Name |
|---|
| (2S)-amino(3,5-dihydroxyphenyl)acetic acid |
| Synonym | Source |
|---|---|
| L-3,5-Dihydroxyphenylglycine | KEGG COMPOUND |