EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H11NO3 |
| Net Charge | 0 |
| Average Mass | 193.202 |
| Monoisotopic Mass | 193.07389 |
| SMILES | CC(=O)N[C@H](C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C10H11NO3/c1-7(12)11-9(10(13)14)8-5-3-2-4-6-8/h2-6,9H,1H3,(H,11,12)(H,13,14)/t9-/m0/s1 |
| InChIKey | VKDFZMMOLPIWQQ-VIFPVBQESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-acetyl-L-α-phenylglycine (CHEBI:137652) has functional parent L-α-phenylglycine (CHEBI:439819) |
| N-acetyl-L-α-phenylglycine (CHEBI:137652) is a N-acyl-L-α-amino acid (CHEBI:48927) |
| N-acetyl-L-α-phenylglycine (CHEBI:137652) is a glycine derivative (CHEBI:24373) |
| N-acetyl-L-α-phenylglycine (CHEBI:137652) is a non-proteinogenic amino acid derivative (CHEBI:83812) |
| N-acetyl-L-α-phenylglycine (CHEBI:137652) is conjugate acid of N-acetyl-L-α-phenylglycinate (CHEBI:136766) |
| Incoming Relation(s) |
| N-acetyl-L-α-phenylglycinate (CHEBI:136766) is conjugate base of N-acetyl-L-α-phenylglycine (CHEBI:137652) |
| IUPAC Name |
|---|
| (2S)-acetamido(phenyl)acetic acid |
| Synonyms | Source |
|---|---|
| N-Acetylphenylglycine | ChemIDplus |
| N-Acetyl-L-phenylglycine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3201695 | Reaxys |
| CAS:29633-99-6 | ChemIDplus |
| Citations |
|---|