EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H9NO2 |
| Net Charge | 0 |
| Average Mass | 151.165 |
| Monoisotopic Mass | 151.06333 |
| SMILES | [NH3+][C@H](C(=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C8H9NO2/c9-7(8(10)11)6-4-2-1-3-5-6/h1-5,7H,9H2,(H,10,11)/t7-/m0/s1 |
| InChIKey | ZGUNAGUHMKGQNY-ZETCQYMHSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-α-phenylglycine zwitterion (CHEBI:136765) is a L-α-amino acid zwitterion (CHEBI:59869) |
| L-α-phenylglycine zwitterion (CHEBI:136765) is tautomer of L-α-phenylglycine (CHEBI:439819) |
| Incoming Relation(s) |
| 2-(2-chlorophenyl)-L-glycine zwitterion (CHEBI:760915) has functional parent L-α-phenylglycine zwitterion (CHEBI:136765) |
| L-α-phenylglycine (CHEBI:439819) is tautomer of L-α-phenylglycine zwitterion (CHEBI:136765) |
| IUPAC Name |
|---|
| (2S)-azaniumyl(phenyl)acetate |
| UniProt Name | Source |
|---|---|
| L-α-phenylglycine | UniProt |