EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H14O7 |
| Net Charge | 0 |
| Average Mass | 306.270 |
| Monoisotopic Mass | 306.07395 |
| SMILES | Oc1cc(O)c2c(c1)O[C@H](c1cc(O)c(O)c(O)c1)[C@H](O)C2 |
| InChI | InChI=1S/C15H14O7/c16-7-3-9(17)8-5-12(20)15(22-13(8)4-7)6-1-10(18)14(21)11(19)2-6/h1-4,12,15-21H,5H2/t12-,15-/m1/s1 |
| InChIKey | XMOCLSLCDHWDHP-IUODEOHRSA-N |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | food component A physiological role played by any substance that is distributed in foodstuffs. It includes materials derived from plants or animals, such as vitamins or minerals, as well as environmental contaminants. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-epigallocatechin (CHEBI:42255) has role antioxidant (CHEBI:22586) |
| (−)-epigallocatechin (CHEBI:42255) has role food component (CHEBI:78295) |
| (−)-epigallocatechin (CHEBI:42255) has role plant metabolite (CHEBI:76924) |
| (−)-epigallocatechin (CHEBI:42255) is a catechin (CHEBI:23053) |
| (−)-epigallocatechin (CHEBI:42255) is a flavan-3,3',4',5,5',7-hexol (CHEBI:71224) |
| (−)-epigallocatechin (CHEBI:42255) is enantiomer of (+)-epigallocatechin (CHEBI:71227) |
| Incoming Relation(s) |
| (+)-catechin-(4α→8)-(−)-epigallocatechin (CHEBI:75667) has functional parent (−)-epigallocatechin (CHEBI:42255) |
| (−)-epicatechin-(4β→8)-(−)-epigallocatechin (CHEBI:75670) has functional parent (−)-epigallocatechin (CHEBI:42255) |
| (−)-epigallocatechin 3-gallate (CHEBI:4806) has functional parent (−)-epigallocatechin (CHEBI:42255) |
| (−)-epigallocatechin-(4β→6)-(+)-catechin (CHEBI:75673) has functional parent (−)-epigallocatechin (CHEBI:42255) |
| (−)-epigallocatechin-(4β→8)-(−)-epicatechin (CHEBI:75669) has functional parent (−)-epigallocatechin (CHEBI:42255) |
| epigallocatechin-(4β→8,2β→O-7)-epicatechin (CHEBI:65854) has functional parent (−)-epigallocatechin (CHEBI:42255) |
| (+)-epigallocatechin (CHEBI:71227) is enantiomer of (−)-epigallocatechin (CHEBI:42255) |
| IUPAC Name |
|---|
| (2R,3R)-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol |
| Synonyms | Source |
|---|---|
| 2,3-cis-epigallocatechin | MetaCyc |
| (2R,3R)-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol | PDBeChem |
| (-)-3,3',4',5,5',7-Flavanhexol | ChemIDplus |
| (-)-Epigallocatechin | KEGG COMPOUND |
| Epigallocatechol | KEGG COMPOUND |
| Epigallocatechol | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00008818 | KNApSAcK |
| C12136 | KEGG COMPOUND |
| CPD-10411 | MetaCyc |
| EGT | PDBeChem |
| HMDB0038361 | HMDB |
| LMPK12020004 | LIPID MAPS |
| LSM-20967 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3655868 | Beilstein |
| Reaxys:94057 | Reaxys |
| CAS:970-74-1 | ChemIDplus |
| CAS:970-74-1 | KEGG COMPOUND |
| Citations |
|---|