EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H14O7 |
| Net Charge | 0 |
| Average Mass | 306.270 |
| Monoisotopic Mass | 306.07395 |
| SMILES | Oc1cc(O)c2c(c1)O[C@H](c1cc(O)c(O)c(O)c1)[C@H](O)C2 |
| InChI | InChI=1S/C15H14O7/c16-7-3-9(17)8-5-12(20)15(22-13(8)4-7)6-1-10(18)14(21)11(19)2-6/h1-4,12,15-21H,5H2/t12-,15-/m1/s1 |
| InChIKey | XMOCLSLCDHWDHP-IUODEOHRSA-N |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. food component A physiological role played by any substance that is distributed in foodstuffs. It includes materials derived from plants or animals, such as vitamins or minerals, as well as environmental contaminants. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-epigallocatechin (CHEBI:42255) has role antioxidant (CHEBI:22586) |
| (−)-epigallocatechin (CHEBI:42255) has role food component (CHEBI:78295) |
| (−)-epigallocatechin (CHEBI:42255) has role plant metabolite (CHEBI:76924) |
| (−)-epigallocatechin (CHEBI:42255) is a catechin (CHEBI:23053) |
| (−)-epigallocatechin (CHEBI:42255) is a flavan-3,3',4',5,5',7-hexol (CHEBI:71224) |
| (−)-epigallocatechin (CHEBI:42255) is enantiomer of (+)-epigallocatechin (CHEBI:71227) |
| Incoming Relation(s) |
| (+)-catechin-(4α→8)-(−)-epigallocatechin (CHEBI:75667) has functional parent (−)-epigallocatechin (CHEBI:42255) |
| (−)-epicatechin-(4β→8)-(−)-epigallocatechin (CHEBI:75670) has functional parent (−)-epigallocatechin (CHEBI:42255) |
| (−)-epigallocatechin 3-gallate (CHEBI:4806) has functional parent (−)-epigallocatechin (CHEBI:42255) |
| (−)-epigallocatechin-(4β→6)-(+)-catechin (CHEBI:75673) has functional parent (−)-epigallocatechin (CHEBI:42255) |
| (−)-epigallocatechin-(4β→8)-(−)-epicatechin (CHEBI:75669) has functional parent (−)-epigallocatechin (CHEBI:42255) |
| epigallocatechin-(4β→8,2β→O-7)-epicatechin (CHEBI:65854) has functional parent (−)-epigallocatechin (CHEBI:42255) |
| (+)-epigallocatechin (CHEBI:71227) is enantiomer of (−)-epigallocatechin (CHEBI:42255) |
| IUPAC Name |
|---|
| (2R,3R)-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol |
| Synonyms | Source |
|---|---|
| 2,3-cis-epigallocatechin | MetaCyc |
| (2R,3R)-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol | PDBeChem |
| (-)-3,3',4',5,5',7-Flavanhexol | ChemIDplus |
| (-)-Epigallocatechin | KEGG COMPOUND |
| Epigallocatechol | KEGG COMPOUND |
| Epigallocatechol | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00008818 | KNApSAcK |
| C12136 | KEGG COMPOUND |
| CPD-10411 | MetaCyc |
| EGT | PDBeChem |
| HMDB0038361 | HMDB |
| LMPK12020004 | LIPID MAPS |
| LSM-20967 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3655868 | Beilstein |
| Reaxys:94057 | Reaxys |
| CAS:970-74-1 | ChemIDplus |
| CAS:970-74-1 | KEGG COMPOUND |
| Citations |
|---|