EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H26O13 |
| Net Charge | 0 |
| Average Mass | 594.525 |
| Monoisotopic Mass | 594.13734 |
| SMILES | Oc1cc(O)c2c(c1)O[C@H](c1cc(O)c(O)c(O)c1)[C@H](O)[C@H]2c1c(O)cc2c(c1O)C[C@H](O)[C@@H](c1ccc(O)c(O)c1)O2 |
| InChI | InChI=1S/C30H26O13/c31-12-6-16(34)23-22(7-12)43-30(11-4-18(36)27(40)19(37)5-11)28(41)25(23)24-17(35)9-21-13(26(24)39)8-20(38)29(42-21)10-1-2-14(32)15(33)3-10/h1-7,9,20,25,28-41H,8H2/t20-,25+,28+,29+,30+/m0/s1 |
| InChIKey | SNJZSALXDDQVRR-DJUYLCBNSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-epigallocatechin-(4β→6)-(+)-catechin (CHEBI:75673) has functional parent (+)-catechin (CHEBI:15600) |
| (−)-epigallocatechin-(4β→6)-(+)-catechin (CHEBI:75673) has functional parent (−)-epigallocatechin (CHEBI:42255) |
| (−)-epigallocatechin-(4β→6)-(+)-catechin (CHEBI:75673) has role metabolite (CHEBI:25212) |
| (−)-epigallocatechin-(4β→6)-(+)-catechin (CHEBI:75673) is a biflavonoid (CHEBI:50128) |
| (−)-epigallocatechin-(4β→6)-(+)-catechin (CHEBI:75673) is a hydroxyflavan (CHEBI:72010) |
| (−)-epigallocatechin-(4β→6)-(+)-catechin (CHEBI:75673) is a polyphenol (CHEBI:26195) |
| (−)-epigallocatechin-(4β→6)-(+)-catechin (CHEBI:75673) is a proanthocyanidin (CHEBI:26267) |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9464607 | Reaxys |