EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H24O13 |
| Net Charge | 0 |
| Average Mass | 592.509 |
| Monoisotopic Mass | 592.12169 |
| SMILES | [H][C@@]12c3c(O)cc(O)cc3O[C@@](c3cc(O)c(O)c(O)c3)(Oc3cc(O)c4c(c31)O[C@]([H])(c1ccc(O)c(O)c1)[C@H](O)C4)[C@@H]2O |
| InChI | InChI=1S/C30H24O13/c31-12-6-17(35)23-21(7-12)42-30(11-4-18(36)26(39)19(37)5-11)29(40)25(23)24-22(43-30)9-15(33)13-8-20(38)27(41-28(13)24)10-1-2-14(32)16(34)3-10/h1-7,9,20,25,27,29,31-40H,8H2/t20-,25-,27-,29-,30+/m1/s1 |
| InChIKey | WODBGULXKVZGQF-QCPBNORNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Xanthoceras sorbifolium (ncbitaxon:99658) | xylem (BTO:0001468) | PubMed (10691716) | Previous component: wood; Methanolic extract of wood |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. HIV protease inhibitor An inhibitor of HIV protease, an enzyme required for production of proteins needed for viral assembly. |
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| epigallocatechin-(4β→8,2β→O-7)-epicatechin (CHEBI:65854) has functional parent (−)-epicatechin (CHEBI:90) |
| epigallocatechin-(4β→8,2β→O-7)-epicatechin (CHEBI:65854) has functional parent (−)-epigallocatechin (CHEBI:42255) |
| epigallocatechin-(4β→8,2β→O-7)-epicatechin (CHEBI:65854) has role HIV protease inhibitor (CHEBI:35660) |
| epigallocatechin-(4β→8,2β→O-7)-epicatechin (CHEBI:65854) has role metabolite (CHEBI:25212) |
| epigallocatechin-(4β→8,2β→O-7)-epicatechin (CHEBI:65854) is a proanthocyanidin (CHEBI:26267) |
| IUPAC Name |
|---|
| (2R,3R,8S,14R,15R)-2-(3,4-dihydroxyphenyl)-8-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H,14H-8,14-methanochromeno[7,8-d][1,3]benzodioxocine-3,5,11,13,15-pentol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8532288 | Reaxys |
| Citations |
|---|