EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H18O11 |
| Net Charge | 0 |
| Average Mass | 458.375 |
| Monoisotopic Mass | 458.08491 |
| SMILES | O=C(O[C@@H]1Cc2c(O)cc(O)cc2O[C@@H]1c1cc(O)c(O)c(O)c1)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C22H18O11/c23-10-5-12(24)11-7-18(33-22(31)9-3-15(27)20(30)16(28)4-9)21(32-17(11)6-10)8-1-13(25)19(29)14(26)2-8/h1-6,18,21,23-30H,7H2/t18-,21-/m1/s1 |
| InChIKey | WMBWREPUVVBILR-WIYYLYMNSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Camellia sinensis (ncbitaxon:4442) | |||
| - | PubMed (21434603) | ||
| - | MetaboLights (MTBLS403) | From MetaboLights | |
| Parapiptadenia rigida (ncbitaxon:148713) | bark (BTO:0001301) | PubMed (21080642) | Ethanolic extract of air-dried, powdered bark |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. Hsp90 inhibitor An EC 3.6.4.10 (non-chaperonin molecular chaperone ATPase) inhibitor that blocks the action of heat shock protein 90. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-epigallocatechin 3-gallate (CHEBI:4806) has functional parent (−)-epigallocatechin (CHEBI:42255) |
| (−)-epigallocatechin 3-gallate (CHEBI:4806) has role antineoplastic agent (CHEBI:35610) |
| (−)-epigallocatechin 3-gallate (CHEBI:4806) has role antioxidant (CHEBI:22586) |
| (−)-epigallocatechin 3-gallate (CHEBI:4806) has role apoptosis inducer (CHEBI:68495) |
| (−)-epigallocatechin 3-gallate (CHEBI:4806) has role geroprotector (CHEBI:176497) |
| (−)-epigallocatechin 3-gallate (CHEBI:4806) has role Hsp90 inhibitor (CHEBI:63962) |
| (−)-epigallocatechin 3-gallate (CHEBI:4806) has role neuroprotective agent (CHEBI:63726) |
| (−)-epigallocatechin 3-gallate (CHEBI:4806) has role plant metabolite (CHEBI:76924) |
| (−)-epigallocatechin 3-gallate (CHEBI:4806) is a flavans (CHEBI:38672) |
| (−)-epigallocatechin 3-gallate (CHEBI:4806) is a gallate ester (CHEBI:37576) |
| (−)-epigallocatechin 3-gallate (CHEBI:4806) is a polyphenol (CHEBI:26195) |
| Incoming Relation(s) |
| theasinensin A (CHEBI:9518) has functional parent (−)-epigallocatechin 3-gallate (CHEBI:4806) |
| IUPAC Name |
|---|
| (2R,3R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl 3,4,5-trihydroxybenzoate |
| Synonyms | Source |
|---|---|
| [(2R,3R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate | ChEBI |
| 3-O-galloyl-(−)-epigallocatechin | ChEBI |
| EGCG | ChemIDplus |
| (−)-epigallocatechin 3-O-gallate | ChEBI |
| (−)-epigallocatechin-3-O-gallate | ChemIDplus |
| epigallocatechin 3-O-gallate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 58575 | ChemSpider |
| C00000958 | KNApSAcK |
| C09731 | KEGG COMPOUND |
| CN102600212 | Patent |
| CN102763743 | Patent |
| Epigallocatechin_gallate | Wikipedia |
| HMDB0003153 | HMDB |
| KDH | PDBeChem |
| LMPK12030005 | LIPID MAPS |
| LSM-5661 | LINCS |
| US2012309821 | Patent |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3658838 | Beilstein |
| Reaxys:67944 | Reaxys |
| CAS:989-51-5 | KEGG COMPOUND |
| CAS:989-51-5 | ChemIDplus |
| Citations |
|---|