EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H18O11 |
| Net Charge | 0 |
| Average Mass | 458.375 |
| Monoisotopic Mass | 458.08491 |
| SMILES | O=C(O[C@@H]1Cc2c(O)cc(O)cc2O[C@@H]1c1cc(O)c(O)c(O)c1)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C22H18O11/c23-10-5-12(24)11-7-18(33-22(31)9-3-15(27)20(30)16(28)4-9)21(32-17(11)6-10)8-1-13(25)19(29)14(26)2-8/h1-6,18,21,23-30H,7H2/t18-,21-/m1/s1 |
| InChIKey | WMBWREPUVVBILR-WIYYLYMNSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Camellia sinensis (ncbitaxon:4442) | |||
| - | PubMed (21434603) | ||
| - | MetaboLights (MTBLS403) | From MetaboLights | |
| Parapiptadenia rigida (ncbitaxon:148713) | bark (BTO:0001301) | PubMed (21080642) | Ethanolic extract of air-dried, powdered bark |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | Hsp90 inhibitor An EC 3.6.4.10 (non-chaperonin molecular chaperone ATPase) inhibitor that blocks the action of heat shock protein 90. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-epigallocatechin 3-gallate (CHEBI:4806) has functional parent (−)-epigallocatechin (CHEBI:42255) |
| (−)-epigallocatechin 3-gallate (CHEBI:4806) has role antineoplastic agent (CHEBI:35610) |
| (−)-epigallocatechin 3-gallate (CHEBI:4806) has role antioxidant (CHEBI:22586) |
| (−)-epigallocatechin 3-gallate (CHEBI:4806) has role apoptosis inducer (CHEBI:68495) |
| (−)-epigallocatechin 3-gallate (CHEBI:4806) has role geroprotector (CHEBI:176497) |
| (−)-epigallocatechin 3-gallate (CHEBI:4806) has role Hsp90 inhibitor (CHEBI:63962) |
| (−)-epigallocatechin 3-gallate (CHEBI:4806) has role neuroprotective agent (CHEBI:63726) |
| (−)-epigallocatechin 3-gallate (CHEBI:4806) has role plant metabolite (CHEBI:76924) |
| (−)-epigallocatechin 3-gallate (CHEBI:4806) is a flavans (CHEBI:38672) |
| (−)-epigallocatechin 3-gallate (CHEBI:4806) is a gallate ester (CHEBI:37576) |
| (−)-epigallocatechin 3-gallate (CHEBI:4806) is a polyphenol (CHEBI:26195) |
| Incoming Relation(s) |
| theasinensin A (CHEBI:9518) has functional parent (−)-epigallocatechin 3-gallate (CHEBI:4806) |
| IUPAC Name |
|---|
| (2R,3R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl 3,4,5-trihydroxybenzoate |
| Synonyms | Source |
|---|---|
| epigallocatechin 3-gallate | KEGG COMPOUND |
| (−)-epigallocatechin-3-O-gallate | ChemIDplus |
| EGCG | ChemIDplus |
| [(2R,3R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate | ChEBI |
| (−)-epigallocatechin gallate | ChemIDplus |
| (−)-epigallocatechol gallate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C09731 | KEGG COMPOUND |
| Epigallocatechin_gallate | Wikipedia |
| US2012309821 | Patent |
| CN102763743 | Patent |
| CN102600212 | Patent |
| LMPK12030005 | LIPID MAPS |
| HMDB0003153 | HMDB |
| C00000958 | KNApSAcK |
| KDH | PDBeChem |
| LSM-5661 | LINCS |
| 58575 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3658838 | Beilstein |
| Reaxys:67944 | Reaxys |
| CAS:989-51-5 | KEGG COMPOUND |
| CAS:989-51-5 | ChemIDplus |
| Citations |
|---|