EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H13NO2 |
| Net Charge | 0 |
| Average Mass | 131.175 |
| Monoisotopic Mass | 131.09463 |
| SMILES | CCCC[C@@H](N)C(=O)O |
| InChI | InChI=1S/C6H13NO2/c1-2-3-4-5(7)6(8)9/h5H,2-4,7H2,1H3,(H,8,9)/t5-/m1/s1 |
| InChIKey | LRQKBLKVPFOOQJ-RXMQYKEDSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-norleucine (CHEBI:42101) is a 2-aminohexanoic acid (CHEBI:36405) |
| D-norleucine (CHEBI:42101) is enantiomer of L-norleucine (CHEBI:18347) |
| D-norleucine (CHEBI:42101) is tautomer of D-norleucine zwitterion (CHEBI:143080) |
| Incoming Relation(s) |
| (2R,5S)-2,5-diaminohexanoic acid (CHEBI:138193) has functional parent D-norleucine (CHEBI:42101) |
| L-norleucine (CHEBI:18347) is enantiomer of D-norleucine (CHEBI:42101) |
| D-norleucine zwitterion (CHEBI:143080) is tautomer of D-norleucine (CHEBI:42101) |
| IUPAC Name |
|---|
| (2R)-2-aminohexanoic acid |
| Synonyms | Source |
|---|---|
| D-NORLEUCINE | PDBeChem |
| D-2-aminohexanoic acid | ChEBI |
| D-(−)-norleucine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| DNE | PDBeChem |
| US2011059503 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1721749 | Reaxys |
| Beilstein:1721749 | Beilstein |
| Gmelin:261031 | Gmelin |
| CAS:327-56-0 | ChemIDplus |
| Citations |
|---|