EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H13NO2 |
| Net Charge | 0 |
| Average Mass | 131.175 |
| Monoisotopic Mass | 131.09463 |
| SMILES | CCCCC(N)C(=O)O |
| InChI | InChI=1S/C6H13NO2/c1-2-3-4-5(7)6(8)9/h5H,2-4,7H2,1H3,(H,8,9) |
| InChIKey | LRQKBLKVPFOOQJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-aminohexanoic acid (CHEBI:36405) has functional parent hexanoic acid (CHEBI:30776) |
| 2-aminohexanoic acid (CHEBI:36405) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| Incoming Relation(s) |
| D-norleucine (CHEBI:42101) is a 2-aminohexanoic acid (CHEBI:36405) |
| L-norleucine (CHEBI:18347) is a 2-aminohexanoic acid (CHEBI:36405) |
| IUPAC Name |
|---|
| 2-aminohexanoic acid |
| Synonyms | Source |
|---|---|
| norleucine | ChemIDplus |
| Nle | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Norleucine | Wikipedia |
| Citations |
|---|