EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H14N2O2 |
| Net Charge | 0 |
| Average Mass | 146.190 |
| Monoisotopic Mass | 146.10553 |
| SMILES | C[C@H](N)CC[C@@H](N)C(=O)O |
| InChI | InChI=1S/C6H14N2O2/c1-4(7)2-3-5(8)6(9)10/h4-5H,2-3,7-8H2,1H3,(H,9,10)/t4-,5+/m0/s1 |
| InChIKey | CEVCRLBFUJAKOG-CRCLSJGQSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2R,5S)-2,5-diaminohexanoic acid (CHEBI:138193) has functional parent D-norleucine (CHEBI:42101) |
| (2R,5S)-2,5-diaminohexanoic acid (CHEBI:138193) is a diamino acid (CHEBI:35987) |
| (2R,5S)-2,5-diaminohexanoic acid (CHEBI:138193) is conjugate base of (2R,5S)-2,5-diammoniohexanoate (CHEBI:137487) |
| Incoming Relation(s) |
| (2R,5S)-2,5-diammoniohexanoate (CHEBI:137487) is conjugate acid of (2R,5S)-2,5-diaminohexanoic acid (CHEBI:138193) |
| IUPAC Name |
|---|
| (5S)-5-amino-D-norleucine |
| Citations |
|---|