EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:18347 - L-norleucine
| Formula | C6H13NO2 |
| Net Charge | 0 |
| Average Mass | 131.175 |
| Monoisotopic Mass | 131.09463 |
| SMILES | CCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C6H13NO2/c1-2-3-4-5(7)6(8)9/h5H,2-4,7H2,1H3,(H,8,9)/t5-/m0/s1 |
| InChIKey | LRQKBLKVPFOOQJ-YFKPBYRVSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-norleucine (CHEBI:18347) is a 2-aminohexanoic acid (CHEBI:36405) |
| L-norleucine (CHEBI:18347) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| L-norleucine (CHEBI:18347) is conjugate acid of L-2-aminohexanoate (CHEBI:21203) |
| L-norleucine (CHEBI:18347) is enantiomer of D-norleucine (CHEBI:42101) |
| L-norleucine (CHEBI:18347) is tautomer of L-2-aminohexanoic acid zwitterion (CHEBI:58455) |
| Incoming Relation(s) |
| (S)-2-amino-6-boronohexanoic acid (CHEBI:40520) has functional parent L-norleucine (CHEBI:18347) |
| L-2-aminohexanoate (CHEBI:21203) is conjugate base of L-norleucine (CHEBI:18347) |
| D-norleucine (CHEBI:42101) is enantiomer of L-norleucine (CHEBI:18347) |
| L-2-aminohexanoic acid zwitterion (CHEBI:58455) is tautomer of L-norleucine (CHEBI:18347) |
| IUPAC Names |
|---|
| (2S)-2-aminohexanoic acid |
| L-norleucine |
| Synonyms | Source |
|---|---|
| L-Norleucine | KEGG COMPOUND |
| L-Aminohexanoic acid | KEGG COMPOUND |
| L-Aminohexanoate | KEGG COMPOUND |
| L-2-Aminohexanoic acid | KEGG COMPOUND |
| L-2-Aminohexanoate | KEGG COMPOUND |
| (S)-2-Aminohexanoic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C01933 | KEGG COMPOUND |
| NLE | PDBeChem |
| LMFA01100042 | LIPID MAPS |
| Norleucine | Wikipedia |
| DB04419 | DrugBank |
| L-2-AMINOHEXANOATE | MetaCyc |
| HMDB0001645 | HMDB |