EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H12N2O |
| Net Charge | 0 |
| Average Mass | 212.252 |
| Monoisotopic Mass | 212.09496 |
| SMILES | O=C(Nc1ccccc1)Nc1ccccc1 |
| InChI | InChI=1S/C13H12N2O/c16-13(14-11-7-3-1-4-8-11)15-12-9-5-2-6-10-12/h1-10H,(H2,14,15,16) |
| InChIKey | GWEHVDNNLFDJLR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. cytokinin A phytohormone that promote cell division, or cytokinesis, in plant roots and shoots. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,3-diphenylurea (CHEBI:41320) has role cytokinin (CHEBI:23530) |
| 1,3-diphenylurea (CHEBI:41320) has role plant metabolite (CHEBI:76924) |
| 1,3-diphenylurea (CHEBI:41320) is a phenylureas (CHEBI:134043) |
| Incoming Relation(s) |
| flucofuron (CHEBI:59242) has functional parent 1,3-diphenylurea (CHEBI:41320) |
| sulcofuron (CHEBI:59246) has functional parent 1,3-diphenylurea (CHEBI:41320) |
| triclocarban (CHEBI:48347) has functional parent 1,3-diphenylurea (CHEBI:41320) |
| IUPAC Name |
|---|
| 1,3-diphenylurea |
| Synonyms | Source |
|---|---|
| 1,3-diphenylcarbamide | ChemIDplus |
| 1,3-DIPHENYLUREA | PDBeChem |
| carbanilide | ChemIDplus |
| diphenylcarbamide | ChemIDplus |
| diphenylurea | ChemIDplus |
| N,N'-diphenylurea | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| BSU | PDBeChem |
| DB07496 | DrugBank |
| HMDB0032066 | HMDB |
| US2010273876 | Patent |
| Citations |
|---|