EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H9Cl3N2O |
| Net Charge | 0 |
| Average Mass | 315.587 |
| Monoisotopic Mass | 313.97805 |
| SMILES | O=C(Nc1ccc(Cl)cc1)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H9Cl3N2O/c14-8-1-3-9(4-2-8)17-13(19)18-10-5-6-11(15)12(16)7-10/h1-7H,(H2,17,18,19) |
| InChIKey | ICUTUKXCWQYESQ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. disinfectant An antimicrobial agent that is applied to non-living objects to destroy harmful microorganisms or to inhibit their activity. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antiseptic drug A substance used locally on humans and other animals to destroy harmful microorganisms or to inhibit their activity (cf. disinfectants, which destroy microorganisms found on non-living objects, and antibiotics, which can be transported through the lymphatic system to destroy bacteria within the body). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triclocarban (CHEBI:48347) has functional parent 1,3-diphenylurea (CHEBI:41320) |
| triclocarban (CHEBI:48347) has role antimicrobial agent (CHEBI:33281) |
| triclocarban (CHEBI:48347) has role antiseptic drug (CHEBI:48218) |
| triclocarban (CHEBI:48347) has role disinfectant (CHEBI:48219) |
| triclocarban (CHEBI:48347) has role environmental contaminant (CHEBI:78298) |
| triclocarban (CHEBI:48347) has role xenobiotic (CHEBI:35703) |
| triclocarban (CHEBI:48347) is a dichlorobenzene (CHEBI:23697) |
| triclocarban (CHEBI:48347) is a monochlorobenzenes (CHEBI:83403) |
| triclocarban (CHEBI:48347) is a phenylureas (CHEBI:134043) |
| IUPAC Name |
|---|
| 1-(4-chlorophenyl)-3-(3,4-dichlorophenyl)urea |
| INNs | Source |
|---|---|
| triclocarban | ChemIDplus |
| triclocarbanum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-(3',4'-dichlorophenyl)-3-(4'-chlorophenyl)urea | NIST Chemistry WebBook |
| 3,4,4'-trichloro carbanilide | NIST Chemistry WebBook |
| 3,4,4'-trichlorocarbanilide | ChemIDplus |
| 3,4,4'-trichlorodiphenylurea | ChemIDplus |
| N-(4-chlorophenyl)-N'-(3,4-dichlorophenyl)urea | ChemIDplus |
| TCC | ChemIDplus |
| Brand Names | Source |
|---|---|
| Cutisan | ChemIDplus |
| Nobacter | NIST Chemistry WebBook |
| Solubacter | ChemIDplus |
| Citations |
|---|