EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:59246 - sulcofuron
| Formula | C19H12Cl4N2O5S |
| Net Charge | 0 |
| Average Mass | 522.193 |
| Monoisotopic Mass | 519.92210 |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)Nc1cc(Cl)ccc1Oc1ccc(Cl)cc1S(=O)(=O)O |
| InChI | InChI=1S/C19H12Cl4N2O5S/c20-10-1-5-16(30-17-6-2-11(21)8-18(17)31(27,28)29)15(7-10)25-19(26)24-12-3-4-13(22)14(23)9-12/h1-9H,(H2,24,25,26)(H,27,28,29) |
| InChIKey | MKUMTCOTMQPYTQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| Applications: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulcofuron (CHEBI:59246) has functional parent 1,3-diphenylurea (CHEBI:41320) |
| sulcofuron (CHEBI:59246) has role epitope (CHEBI:53000) |
| sulcofuron (CHEBI:59246) has role insecticide (CHEBI:24852) |
| sulcofuron (CHEBI:59246) is a arenesulfonic acid (CHEBI:33555) |
| sulcofuron (CHEBI:59246) is a dichlorobenzene (CHEBI:23697) |
| sulcofuron (CHEBI:59246) is a organochlorine pesticide (CHEBI:38656) |
| sulcofuron (CHEBI:59246) is a phenylureas (CHEBI:134043) |
| sulcofuron (CHEBI:59246) is conjugate acid of sulcofuronate (CHEBI:59248) |
| Incoming Relation(s) |
| sulcofuronate (CHEBI:59248) is conjugate base of sulcofuron (CHEBI:59246) |
| IUPAC Name |
|---|
| 5-chloro-2-(4-chloro-2-{[(3,4-dichlorophenyl)carbamoyl]amino}phenoxy)benzene-1-sulfonic acid |
| Manual Xrefs | Databases |
|---|---|
| sulcofuron | Alan Wood's Pesticides |
| US5912270 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3517243 | Reaxys |
| CAS:24019-05-4 | ChemIDplus |
| Citations |
|---|