EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H8Cl2F6N2O |
| Net Charge | 0 |
| Average Mass | 417.136 |
| Monoisotopic Mass | 415.99179 |
| SMILES | O=C(Nc1ccc(Cl)c(C(F)(F)F)c1)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H8Cl2F6N2O/c16-11-3-1-7(5-9(11)14(18,19)20)24-13(26)25-8-2-4-12(17)10(6-8)15(21,22)23/h1-6H,(H2,24,25,26) |
| InChIKey | ABOVRDBEJDIBMZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| Applications: | pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| flucofuron (CHEBI:59242) has functional parent 1,3-diphenylurea (CHEBI:41320) |
| flucofuron (CHEBI:59242) has role epitope (CHEBI:53000) |
| flucofuron (CHEBI:59242) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| flucofuron (CHEBI:59242) is a monochlorobenzenes (CHEBI:83403) |
| flucofuron (CHEBI:59242) is a organochlorine pesticide (CHEBI:38656) |
| flucofuron (CHEBI:59242) is a organofluorine pesticide (CHEBI:38805) |
| flucofuron (CHEBI:59242) is a phenylureas (CHEBI:134043) |
| IUPAC Name |
|---|
| N,N'-bis[4-chloro-3-(trifluoromethyl)phenyl]urea |
| Synonyms | Source |
|---|---|
| 1,3-Bis(4-chloro-alpha,alpha,alpha-trifluoro-m-tolyl)urea | ChemIDplus |
| 1,3-bis[4-chloro-3-(trifluoromethyl)phenyl]urea | IUPAC |
| 1,3-bis(4-chloro-α,α,α-trifluoro-m-tolyl)urea | Alan Wood's Pesticides |
| Manual Xrefs | Databases |
|---|---|
| flucofuron | Alan Wood's Pesticides |
| 2917 | PPDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2189316 | Reaxys |
| CAS:370-50-3 | ChemIDplus |
| Citations |
|---|