EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:4027 - cyclophosphamide
| Formula | C7H15Cl2N2O2P |
| Net Charge | 0 |
| Average Mass | 261.089 |
| Monoisotopic Mass | 260.02482 |
| SMILES | O=P1(N(CCCl)CCCl)NCCCO1 |
| InChI | InChI=1S/C7H15Cl2N2O2P/c8-2-5-11(6-3-9)14(12)10-4-1-7-13-14/h1-7H2,(H,10,12) |
| InChIKey | CMSMOCZEIVJLDB-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. alkylating agent Highly reactive chemical that introduces alkyl radicals into biologically active molecules and thereby prevents their proper functioning. It could be used as an antineoplastic agent, but it might be very toxic, with carcinogenic, mutagenic, teratogenic, and immunosuppressant actions. It could also be used as a component of poison gases. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. drug allergen Any drug which causes the onset of an allergic reaction. alkylating agent Highly reactive chemical that introduces alkyl radicals into biologically active molecules and thereby prevents their proper functioning. It could be used as an antineoplastic agent, but it might be very toxic, with carcinogenic, mutagenic, teratogenic, and immunosuppressant actions. It could also be used as a component of poison gases. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. drug allergen Any drug which causes the onset of an allergic reaction. antirheumatic drug A drug used to treat rheumatoid arthritis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cyclophosphamide (CHEBI:4027) has role alkylating agent (CHEBI:22333) |
| cyclophosphamide (CHEBI:4027) has role antineoplastic agent (CHEBI:35610) |
| cyclophosphamide (CHEBI:4027) has role antirheumatic drug (CHEBI:35842) |
| cyclophosphamide (CHEBI:4027) has role carcinogenic agent (CHEBI:50903) |
| cyclophosphamide (CHEBI:4027) has role drug allergen (CHEBI:88188) |
| cyclophosphamide (CHEBI:4027) has role environmental contaminant (CHEBI:78298) |
| cyclophosphamide (CHEBI:4027) has role immunosuppressive agent (CHEBI:35705) |
| cyclophosphamide (CHEBI:4027) has role xenobiotic (CHEBI:35703) |
| cyclophosphamide (CHEBI:4027) is a nitrogen mustard (CHEBI:37598) |
| cyclophosphamide (CHEBI:4027) is a organochlorine compound (CHEBI:36683) |
| cyclophosphamide (CHEBI:4027) is a phosphorodiamide (CHEBI:35467) |
| Incoming Relation(s) |
| cyclophosphamide hydrate (CHEBI:4026) has part cyclophosphamide (CHEBI:4027) |
| IUPAC Name |
|---|
| N,N-bis(2-chloroethyl)-1,3,2-oxazaphosphinan-2-amine 2-oxide |
| Synonyms | Source |
|---|---|
| 2-[Bis(2-chloroethylamino)]-tetrahydro-2H-1,3,2-oxazaphosphorine-2-oxide | NIST Chemistry WebBook |
| Bis(2-chloroethyl)phosphoramide cyclic propanolamide ester | ChemIDplus |
| (+-)-Cyclophosphamide | ChemIDplus |
| Cyclophosphamide anhydrous | KEGG COMPOUND |
| N,N-bis(2-chloroethyl)tetrahydro-2H-1,3,2-oxazaphosphorin-2-amine 2-oxide | IUPAC |
| (RS)-Cyclophosphamide | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 758 | DrugCentral |
| C07888 | KEGG COMPOUND |
| Cyclophosphamide | Wikipedia |
| D07760 | KEGG DRUG |
| DB00531 | DrugBank |
| HMDB0014672 | HMDB |
| LSM-4961 | LINCS |
| Citations |
|---|