EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H25NO3 |
| Net Charge | 0 |
| Average Mass | 291.391 |
| Monoisotopic Mass | 291.18344 |
| SMILES | CN(C)CCOC(=O)C(c1ccccc1)C1(O)CCCC1 |
| InChI | InChI=1S/C17H25NO3/c1-18(2)12-13-21-16(19)15(14-8-4-3-5-9-14)17(20)10-6-7-11-17/h3-5,8-9,15,20H,6-7,10-13H2,1-2H3 |
| InChIKey | SKYSRIRYMSLOIN-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. parasympatholytic Any cholinergic antagonist that inhibits the actions of the parasympathetic nervous system. The major group of drugs used therapeutically for this purpose is the muscarinic antagonists. |
| Applications: | diagnostic agent A substance administered to aid diagnosis of a disease. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. mydriatic agent Agent that dilates the pupil. Used in eye diseases and to facilitate eye examination. It may be either a sympathomimetic or parasympatholytic. The latter cause cycloplegia or paralysis of accommodation at high doses and may precipitate glaucoma. parasympatholytic Any cholinergic antagonist that inhibits the actions of the parasympathetic nervous system. The major group of drugs used therapeutically for this purpose is the muscarinic antagonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cyclopentolate (CHEBI:4024) has functional parent (1-hydroxycyclopentyl)phenylacetic acid (CHEBI:59684) |
| cyclopentolate (CHEBI:4024) has functional parent N,N-dimethylethanolamine (CHEBI:271436) |
| cyclopentolate (CHEBI:4024) has role diagnostic agent (CHEBI:33295) |
| cyclopentolate (CHEBI:4024) has role muscarinic antagonist (CHEBI:48876) |
| cyclopentolate (CHEBI:4024) has role mydriatic agent (CHEBI:50513) |
| cyclopentolate (CHEBI:4024) has role parasympatholytic (CHEBI:50370) |
| cyclopentolate (CHEBI:4024) is a carboxylic ester (CHEBI:33308) |
| cyclopentolate (CHEBI:4024) is a tertiary alcohol (CHEBI:26878) |
| cyclopentolate (CHEBI:4024) is a tertiary amino compound (CHEBI:50996) |
| Incoming Relation(s) |
| cyclopentolate hydrochloride (CHEBI:4025) has part cyclopentolate (CHEBI:4024) |
| (R)-cyclopentolate (CHEBI:59688) is a cyclopentolate (CHEBI:4024) |
| (S)-cyclopentolate (CHEBI:59689) is a cyclopentolate (CHEBI:4024) |
| IUPAC Name |
|---|
| 2-(dimethylamino)ethyl (1-hydroxycyclopentyl)(phenyl)acetate |
| INNs | Source |
|---|---|
| ciclopentolato | ChemIDplus |
| cyclopentolate | ChemIDplus |
| cyclopentolate | WHO MedNet |
| cyclopentolatum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-hydroxy-α-phenylcyclopentaneacetic acid 2-(dimethylamino)ethyl ester | ChEBI |
| 2-(dimethylamino)ethyl 1-hydroxy-α-phenylcyclopentaneacetate | ChemIDplus |
| 2-(dimethylamino)ethyl 2-(1-hydroxycyclopentyl)-2-phenylacetate | ChEBI |
| 2-phenyl-2-(1-hydroxycyclopentyl)ethanoic acid β-(dimethylamino)ethyl ester | ChEBI |
| (±)-cyclopentolate | ChEBI |
| Cyclopentolate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 757 | DrugCentral |
| C06932 | KEGG COMPOUND |
| Cyclopentolate | Wikipedia |
| D07759 | KEGG DRUG |
| DB00979 | DrugBank |
| HMDB0015114 | HMDB |
| LSM-1800 | LINCS |
| US2554511 | Patent |