EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H11NO |
| Net Charge | 0 |
| Average Mass | 89.138 |
| Monoisotopic Mass | 89.08406 |
| SMILES | CN(C)CCO |
| InChI | InChI=1S/C4H11NO/c1-5(2)3-4-6/h6H,3-4H2,1-2H3 |
| InChIKey | UEEJHVSXFDXPFK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | curing agent A chemical additive used to toughen or harden a polymer material by cross-linking of polymer chains. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N,N-dimethylethanolamine (CHEBI:271436) has role curing agent (CHEBI:75358) |
| N,N-dimethylethanolamine (CHEBI:271436) has role radical scavenger (CHEBI:48578) |
| N,N-dimethylethanolamine (CHEBI:271436) is a ethanolamines (CHEBI:23981) |
| N,N-dimethylethanolamine (CHEBI:271436) is a tertiary amine (CHEBI:32876) |
| Incoming Relation(s) |
| cyclopentolate (CHEBI:4024) has functional parent N,N-dimethylethanolamine (CHEBI:271436) |
| IUPAC Name |
|---|
| 2-(dimethylamino)ethanol |
| Synonyms | Source |
|---|---|
| N,N-dimethylethanolamine | ChEBI |
| (2-Hydroxyethyl)dimethylamine | ChemIDplus |
| 2-(Dimethylamino)-1-ethanol | ChemIDplus |
| 2-(N,N-Dimethylamino)ethanol | ChemIDplus |
| 2-Dimethylaminoethanol | ChemIDplus |
| DMAE | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Dimethylethanolamine | Wikipedia |
| HMDB0032231 | HMDB |
| 787 | DrugCentral |
| Citations |
|---|