EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H16O3 |
| Net Charge | 0 |
| Average Mass | 220.268 |
| Monoisotopic Mass | 220.10994 |
| SMILES | O=C(O)C(c1ccccc1)C1(O)CCCC1 |
| InChI | InChI=1S/C13H16O3/c14-12(15)11(10-6-2-1-3-7-10)13(16)8-4-5-9-13/h1-3,6-7,11,16H,4-5,8-9H2,(H,14,15) |
| InChIKey | MHVVPVXRMHIATI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1-hydroxycyclopentyl)phenylacetic acid (CHEBI:59684) is a monocarboxylic acid (CHEBI:25384) |
| (1-hydroxycyclopentyl)phenylacetic acid (CHEBI:59684) is a tertiary alcohol (CHEBI:26878) |
| Incoming Relation(s) |
| cyclopentolate (CHEBI:4024) has functional parent (1-hydroxycyclopentyl)phenylacetic acid (CHEBI:59684) |
| IUPAC Name |
|---|
| (1-hydroxycyclopentyl)(phenyl)acetic acid |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2647013 | Beilstein |
| CAS:25209-52-3 | ChemIDplus |