EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H16N5O7P |
| Net Charge | 0 |
| Average Mass | 361.251 |
| Monoisotopic Mass | 361.07873 |
| SMILES | CNc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C11H16N5O7P/c1-12-9-6-10(14-3-13-9)16(4-15-6)11-8(18)7(17)5(23-11)2-22-24(19,20)21/h3-5,7-8,11,17-18H,2H2,1H3,(H,12,13,14)(H2,19,20,21)/t5-,7-,8-,11-/m1/s1 |
| InChIKey | WETVNPRPZIYMAC-IOSLPCCCSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N6-methyl-AMP (CHEBI:40196) has functional parent adenosine 5'-monophosphate (CHEBI:16027) |
| N6-methyl-AMP (CHEBI:40196) is a purine ribonucleoside 5'-monophosphate (CHEBI:37021) |
| N6-methyl-AMP (CHEBI:40196) is conjugate acid of N6-methyl-AMP(2−) (CHEBI:144842) |
| Incoming Relation(s) |
| N6-methyl-AMP(2−) (CHEBI:144842) is conjugate base of N6-methyl-AMP (CHEBI:40196) |
| N6-methyladenosine 5'-monophosphate residue (CHEBI:74676) is substituent group from N6-methyl-AMP (CHEBI:40196) |
| IUPAC Name |
|---|
| N-methyladenosine 5'-(dihydrogen phosphate) |
| Synonyms | Source |
|---|---|
| N6-methyl-[5']adenylic acid | ChEBI |
| N6-methyl-5'-adenylic acid | ChEBI |
| N6-methyl-5'-phosphoadenosine | ChEBI |
| N6-methyladenosine 5'-monophosphate | ChEBI |
| N6-METHYLADENOSINE-5'-MONOPHOSPHATE | PDBeChem |
| Manual Xrefs | Databases |
|---|---|
| 6MZ | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1048923 | Reaxys |