EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H20N5O6P |
| Net Charge | 0 |
| Average Mass | 373.306 |
| Monoisotopic Mass | 373.11512 |
| SMILES | CNc1ncnc2c1ncn2[C@@H]1O[C@H](COP(C)(=O)O)[C@@H](OC)[C@H]1O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N6-methyladenosine 5'-monophosphate residue (CHEBI:74676) is a nucleotide residue (CHEBI:50319) |
| N6-methyladenosine 5'-monophosphate residue (CHEBI:74676) is conjugate acid of N6-methyladenosine 5'-monophosphate(1−) residue (CHEBI:74449) |
| N6-methyladenosine 5'-monophosphate residue (CHEBI:74676) is substituent group from N6-methyl-AMP (CHEBI:40196) |
| Incoming Relation(s) |
| N6-methyladenosine 5'-monophosphate(1−) residue (CHEBI:74449) is conjugate base of N6-methyladenosine 5'-monophosphate residue (CHEBI:74676) |
| Synonym | Source |
|---|---|
| N6-methyl-AMP residue | ChEBI |