EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H14N5O7P |
| Net Charge | -2 |
| Average Mass | 359.235 |
| Monoisotopic Mass | 359.06418 |
| SMILES | CNc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)([O-])[O-])[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C11H16N5O7P/c1-12-9-6-10(14-3-13-9)16(4-15-6)11-8(18)7(17)5(23-11)2-22-24(19,20)21/h3-5,7-8,11,17-18H,2H2,1H3,(H,12,13,14)(H2,19,20,21)/p-2/t5-,7-,8-,11-/m1/s1 |
| InChIKey | WETVNPRPZIYMAC-IOSLPCCCSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N6-methyl-AMP(2−) (CHEBI:144842) has functional parent adenosine 5'-monophosphate(2−) (CHEBI:456215) |
| N6-methyl-AMP(2−) (CHEBI:144842) is a nucleoside 5'-monophosphate(2−) (CHEBI:58043) |
| N6-methyl-AMP(2−) (CHEBI:144842) is conjugate base of N6-methyl-AMP (CHEBI:40196) |
| Incoming Relation(s) |
| N6-methyl-AMP (CHEBI:40196) is conjugate acid of N6-methyl-AMP(2−) (CHEBI:144842) |
| IUPAC Name |
|---|
| N-methyl-5'-O-phosphonatoadenosine |
| Synonyms | Source |
|---|---|
| N6-methyl-AMP dianion | ChEBI |
| N6-methyladenosine 5'-monophosphate(2−) | ChEBI |
| N6-methyladenosine 5'-monophosphate dianion | ChEBI |
| UniProt Name | Source |
|---|---|
| N6-methyl-AMP | UniProt |
| Citations |
|---|