EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H6N2O2 |
| Net Charge | 0 |
| Average Mass | 102.093 |
| Monoisotopic Mass | 102.04293 |
| SMILES | [H][C@@]1(N)CONC1=O |
| InChI | InChI=1S/C3H6N2O2/c4-2-1-7-5-3(2)6/h2H,1,4H2,(H,5,6)/t2-/m1/s1 |
| InChIKey | DYDCUQKUCUHJBH-UWTATZPHSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. NMDA receptor agonist An excitatory amino acid agonist which binds to NMDA receptors and triggers a response. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. NMDA receptor agonist An excitatory amino acid agonist which binds to NMDA receptors and triggers a response. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-cycloserine (CHEBI:40009) has role antiinfective agent (CHEBI:35441) |
| D-cycloserine (CHEBI:40009) has role antimetabolite (CHEBI:35221) |
| D-cycloserine (CHEBI:40009) has role antitubercular agent (CHEBI:33231) |
| D-cycloserine (CHEBI:40009) has role metabolite (CHEBI:25212) |
| D-cycloserine (CHEBI:40009) has role NMDA receptor agonist (CHEBI:64571) |
| D-cycloserine (CHEBI:40009) is a 4-amino-1,2-oxazolidin-3-one (CHEBI:23503) |
| D-cycloserine (CHEBI:40009) is a organonitrogen heterocyclic antibiotic (CHEBI:25558) |
| D-cycloserine (CHEBI:40009) is a organooxygen heterocyclic antibiotic (CHEBI:25807) |
| D-cycloserine (CHEBI:40009) is conjugate base of D-cycloserine(1+) (CHEBI:75929) |
| D-cycloserine (CHEBI:40009) is enantiomer of L-cycloserine (CHEBI:75592) |
| D-cycloserine (CHEBI:40009) is tautomer of D-cycloserine zwitterion (CHEBI:74159) |
| Incoming Relation(s) |
| DL-cycloserine (CHEBI:27792) has part D-cycloserine (CHEBI:40009) |
| D-cycloserine(1+) (CHEBI:75929) is conjugate acid of D-cycloserine (CHEBI:40009) |
| L-cycloserine (CHEBI:75592) is enantiomer of D-cycloserine (CHEBI:40009) |
| D-cycloserine zwitterion (CHEBI:74159) is tautomer of D-cycloserine (CHEBI:40009) |
| IUPAC Name |
|---|
| (4R)-4-aminoisoxazolidin-3-one |
| INNs | Source |
|---|---|
| cicloserina | ChemIDplus |
| cycloserine | ChemIDplus |
| cyclosérine | WHO MedNet |
| cycloserinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (+)-4-amino-3-isoxazolidinone | ChemIDplus |
| (+)-cycloserine | ChEBI |
| cyclo-D-serine | ChemIDplus |
| DCS | ChemIDplus |
| D-Cycloserine | KEGG COMPOUND |
| D-Cycloserine | ChemIDplus |
| Brand Name | Source |
|---|---|
| Seromycin | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 4AX | PDBeChem |
| 759 | DrugCentral |
| CPD-2482 | MetaCyc |
| Cycloserine | Wikipedia |
| D00877 | KEGG DRUG |
| DB00260 | DrugBank |
| HMDB0014405 | HMDB |
| LMPK14000007 | LIPID MAPS |
| LSM-5932 | LINCS |
| US2772280 | Patent |
| US2840565 | Patent |
| Citations |
|---|