EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H7N2O2 |
| Net Charge | +1 |
| Average Mass | 103.101 |
| Monoisotopic Mass | 103.05020 |
| SMILES | [H][C@@]1([NH3+])CONC1=O |
| InChI | InChI=1S/C3H6N2O2/c4-2-1-7-5-3(2)6/h2H,1,4H2,(H,5,6)/p+1/t2-/m1/s1 |
| InChIKey | DYDCUQKUCUHJBH-UWTATZPHSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-cycloserine(1+) (CHEBI:75929) is a ammonium ion derivative (CHEBI:35274) |
| D-cycloserine(1+) (CHEBI:75929) is a organic cation (CHEBI:25697) |
| D-cycloserine(1+) (CHEBI:75929) is conjugate acid of D-cycloserine (CHEBI:40009) |
| Incoming Relation(s) |
| D-cycloserine (CHEBI:40009) is conjugate base of D-cycloserine(1+) (CHEBI:75929) |
| IUPAC Name |
|---|
| (4R)-3-oxo-1,2-oxazolidin-4-aminium |
| UniProt Name | Source |
|---|---|
| D-cycloserine | UniProt |