EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H6N2O2 |
| Net Charge | 0 |
| Average Mass | 102.093 |
| Monoisotopic Mass | 102.04293 |
| SMILES | [H][C@@]1([NH3+])CO[N-]C1=O |
| InChI | InChI=1S/C3H6N2O2/c4-2-1-7-5-3(2)6/h2H,1,4H2,(H,5,6)/t2-/m1/s1 |
| InChIKey | DYDCUQKUCUHJBH-UWTATZPHSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-cycloserine zwitterion (CHEBI:74159) is a zwitterion (CHEBI:27369) |
| D-cycloserine zwitterion (CHEBI:74159) is tautomer of D-cycloserine (CHEBI:40009) |
| Incoming Relation(s) |
| D-cycloserine (CHEBI:40009) is tautomer of D-cycloserine zwitterion (CHEBI:74159) |
| IUPAC Name |
|---|
| (4R)-4-ammonio-3-oxo-1,2-oxazolidin-2-ide |
| Synonyms | Source |
|---|---|
| (+)-4-amino-3-isoxazolidinone zwitterion | ChEBI |
| (4R)-4-aminoisoxazolidin-3-one zwitterion | ChEBI |
| cycloserine zwitterion | ChEBI |
| D-4-amino-3-isoxazolidinone zwitterion | ChEBI |
| α-cycloserine zwitterion | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-2482 | MetaCyc |
| Citations |
|---|