EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:75592 - L-cycloserine
| Formula | C3H6N2O2 |
| Net Charge | 0 |
| Average Mass | 102.093 |
| Monoisotopic Mass | 102.04293 |
| SMILES | [H][C@]1(N)CONC1=O |
| InChI | InChI=1S/C3H6N2O2/c4-2-1-7-5-3(2)6/h2H,1,4H2,(H,5,6)/t2-/m0/s1 |
| InChIKey | DYDCUQKUCUHJBH-REOHCLBHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. EC 2.3.1.50 (serine C-palmitoyltransferase) inhibitor An EC 2.3.1.* (acyltransferase transferring other than amino-acyl group) inhibitor that interferes with the action of serine palmitoyltransferase (EC 2.3.1.50). |
| Application: | anticonvulsant A drug used to prevent seizures or reduce their severity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-cycloserine (CHEBI:75592) has role anti-HIV agent (CHEBI:64946) |
| L-cycloserine (CHEBI:75592) has role anticonvulsant (CHEBI:35623) |
| L-cycloserine (CHEBI:75592) has role EC 2.3.1.50 (serine C-palmitoyltransferase) inhibitor (CHEBI:59647) |
| L-cycloserine (CHEBI:75592) is a 4-amino-1,2-oxazolidin-3-one (CHEBI:23503) |
| L-cycloserine (CHEBI:75592) is enantiomer of D-cycloserine (CHEBI:40009) |
| Incoming Relation(s) |
| DL-cycloserine (CHEBI:27792) has part L-cycloserine (CHEBI:75592) |
| D-cycloserine (CHEBI:40009) is enantiomer of L-cycloserine (CHEBI:75592) |
| IUPAC Name |
|---|
| (4S)-4-amino-1,2-oxazolidin-3-one |
| INNs | Source |
|---|---|
| levcycloserinum | ChemIDplus |
| levcicloserina | ChemIDplus |
| levcycloserine | ChemIDplus |
| levcyclosérine | WHO MedNet |
| Synonyms | Source |
|---|---|
| (S)-4-amino-isoxazolidin-3-one | ChEBI |
| L-4-aminoisoxazolidin-3-one | ChEBI |
| (S)-(−)-cycloserine | ChemIDplus |
| (−)-cycloserine | ChEBI |
| L-CS | ChEBI |
| (4S)-4-aminoisoxazolidin-3-one | IUPAC |
| Citations |
|---|